Ethaboxam (Ref: LGC 30473) |

Last updated: 23/01/2025
|
 |
(Not known by any other names) |
Ethaboxam is a fungicide used to control soil-borne pathogens. It has a moderate aqueous solubility and is considered to be volatile. Although it has a low mammalian toxicity it has a high potential to bioaccumulate. It is moderately toxic to birds, most aquatic species, honeybees and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A systemic, thiazole fungicide used to control soil-borne pathogens |
|
Blight; Damping-off; Root rot; Seed rot |
|
Vines; Potatoes; Corn; Soybeans; Cereals; vegetables including peas, lentils, chickpeas, beans |
|
- |
|
Considered obsolete but may be available in some countries |
|
1999 Korea first registered |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. Substance is racemic. |
|
C₁₄H₁₆N₄OS₂ |
|
CCC1=C(SC(=N1)NCC)C(=O)NC(C#N)C2=CC=CS2 |
|
- |
|
NQRFDNJEBWAUBL-UHFFFAOYSA-N |
|
InChI=1S/C14H16N4OS2/c1-3-9-12(21-14(18-9)16-4-2)13(19)17-10(8-15)11-6-5-7-20-11/h5-7,10H,3-4H2,1-2H3,(H,16,18)(H,17,19)/f/h16-17H |
|
Yes |
|
Fungicide |
|
Thiazole fungicide |
|
- |
|
- |
|
Synthetic |
|
Systemic with protective and curative action. Inhibition of mitosis and cell division (Beta-tubulin assembly in mitosis). |
|
162650-77-3 |
|
605-299-7 |
|
769 |
|
090205 |
|
11174640 |
|
No data found |
|
320.43 |
|
rac-N-[(R)-cyano(thiophen-2-yl)methyl]-4-ethyl-2-(ethylamino)-1,3-thiazole-5-carboxamide |
|
(RS)-N-(α-cyano-2-thenyl)-4-ethyl-2-(ethylamino)-1,3-thiazole-5-carboxamide |
|
N-(cyano-2-thienylmethyl)-4-ethyl-2-(ethylamino)-5-thiazolecarboxamide |
|
PAN listed Highly Hazardous Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
22 |
|
- |
|
White to pale yellow crystalline powder |
|
|
|
- LG Life Sciences
- Valent
- Sumitomo
- Nippon soda
|
|
- LGC-30473 10% SC
- Guardian
- Intego Solo
- Ethofin
|
|
Usually supplied as an aqueous solution or suspension concentrate. Often used as a seed dressing. |
|
|
|
|
|
12.4 |
|
Moderate |
|
0.39 |
E4 E = Manufacturers safety data sheets 4 = Verified data n-Heptane |
- |
140 |
E4 E = Manufacturers safety data sheets 4 = Verified data Xylene |
- |
11000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Ethyl acetate |
- |
40000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Acetone |
- |
|
185 |
Decomposes |
- |
|
Decomposes before boiling |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
7.76 X 1002 |
Calculated |
- |
|
2.89 |
|
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.28 |
|
- |
|
3.6 |
|
- |
Weak acid |
|
8.10 X 10-02 |
|
Low volatility |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
17 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
17 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Slightly mobile |
|
693 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.43 |
Calculated |
Low leachability |
|
|
2.95 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
4.2 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 yr |
High |
|
100 |
- |
|
- |
- |
- |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
51 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.102 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.365 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.009 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
High |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat |
Low |
|
5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
4.89 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
May damage male reproduction system US EPA - weak evidence to suggest possible human carcinogen |
|
|
|
Not explosive or oxidising Not explected to auto-ignite, Not highly flammable |
|
Environment: H400, H410 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
- |
|
- |
|
- |
|
|
|
ethaboxam |
|
ethaboxam |
|
Ethaboxam |
|
ethaboxam |
|
ethaboxam |
|
etaboxam |
|
- |
|
etaboksam |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |