Ethiofencarb (Ref: BAY 108594) |
![]() Last updated: 19/01/2021 |
![]() |
(Also known as: ethiophencarbe; HOX 1901) |
|
![]() |
|
A phenyl methylcarbamate insecticide used mainly to control aphids | |
---|---|---|
|
Aphids | |
|
Fruit; Vegetables; Sugarbeet; Cotton; Maize; Potatoes; Tobacco; Ornamentals | |
|
- | |
|
Unknown | |
|
circa 1975 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₁H₁₅NO₂S | |
|
CCSCC1=CC=CC=C1OC(=O)NC | |
|
No data | |
|
HEZNVIYQEUHLNI-UHFFFAOYSA-N | |
|
InChI=1S/C11H15NO2S/c1-3-15-8-9-6-4-5-7-10(9)14-11(13)12-2/h4-7H,3,8H2,1-2H3,(H,12,13)/f/h12H | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Carbamate | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic with contact and stomach action. Acetylcholinesterase (AChE) inhibitor. | |
|
29973-13-5 | |
|
249-981-9 | |
|
363 | |
|
112101 | |
|
34766 | |
|
225.31 | |
|
2-[(ethylsulfanyl)methyl]phenyl methylcarbamate | |
|
α-ethylthio-o-tolyl methylcarbamate | |
|
2-[(ethylthio)methyl]phenyl methylcarbamate | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1A | |
|
Not applicable | |
|
Myzus persicae, Phorodon humuli | |
|
Colourless crystals |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually formulated as granules or as an emulsifiable concentrate |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
1900 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
High | ||||||||
|
7500 | L3 L = Pesticide manuals and hard copy reference books / other sources Hexane3 = Unverified data of known source |
- | ||||||||
200000 | L3 L = Pesticide manuals and hard copy reference books / other sources Toluene3 = Unverified data of known source |
- | |||||||||
200000 | L3 L = Pesticide manuals and hard copy reference books / other sources Dichloromethane3 = Unverified data of known source |
- | |||||||||
|
33.4 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Decomposes on distillation | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
|
123 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
1.10 X 1002 | Calculated | - | |||||||
|
2.04 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
Low | ||||||||
|
1.23 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.5 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Low volatility | ||||||||
|
1.17 X 10-04 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
37 | K5 K = Research datasets, e.g. Pandora, Demetra 5 = Verified data used for regulatory purposes |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature DT₅₀ range 34-131 days (R3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | |||||||
|
Rapid in sunlight | ||||||||||
|
|
16 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Non-persistent | |||||||
|
- | ||||||||||
|
52 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderately fast | ||||||||
|
21 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Slow |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | P3 P = Other governments and regulators 3 = Unverified data of known source |
Mobile | |||||||
|
52 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.58 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
5.89 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | - | - | |||||
|
Soil | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
75 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
Low potential | |||||||
|
Not available | - | |||||||||
|
200 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
155 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) Phasianidae3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
3.4 | K3 K = Research datasets, e.g. Pandora, Demetra Unknown species3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
0.22 | K3 K = Research datasets, e.g. Pandora, Demetra Unknown species3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.54 | F3 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) Apis mellifera3 = Unverified data of known source |
Moderate | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
> 0.205 | R3 R = Peer reviewed scientific publications Bombus terrestris3 = Unverified data of known source |
High | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
120 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
Harmful | [Dose: 300 g ha⁻¹] AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Typhlodromus pyri3 = Unverified data of known source |
- | |||
|
|
- | - | - |
|
Harmful | [Dose: 300 g ha⁻¹] AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Chrysoperla carnea3 = Unverified data of known source |
- | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
200 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) Rat3 = Unverified data of known source |
Moderate | ||||||||
|
1000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
0.2 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.1 | F3 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) JMPR 19823 = Unverified data of known source |
- | ||||||||
|
0.15 | B4 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) UK ACP 19994 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Highly toxic |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302 Environment: H400, H410 |
|||
|
Xn - Harmful: R22 N - Dangerous for the environment: R50, R53 |
|||
|
S2, S60, S61 | |||
|
Ib (Highly hazardous / Highly hazardous) | |||
|
2992 | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
ethiofencarb | ||
|
ethiofencarbe | ||
|
Ethiofencarb | ||
|
ethiofencarb | ||
|
etiofencarb | ||
|
etiofencarb | ||
|
ethiofencarb | ||
|
etiofenkarb | ||
|
- | ||
|
- | ||
|
ethiofencarb |
Record last updated: | 19/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |