Ethirimol (Ref: PP149) |

Last updated: 13/09/2023
|
 |
(Also known as: ethyrimol) |
Ethrimol is a pyrimidine fungicide which is not approved for use in the UK nor the EU. It has a moderate water solubility and a low volatility. It is moderately persistent in soils and water bodies. It is moderately mobile. It demonstrates a low to moderate level of toxicity for most species. Data relating to human toxicity is scant. It las a low human toxicity via the oral route. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A pyrimidine fungicide often used as a seed treatment for various diseases. Can also be a pesticide transformation product |
|
Damping-off; Powdery mildew |
|
Cereals including barley, wheat |
|
- |
|
Considered obsolete but may be available in some countries |
|
1968, first reported; 1970, first marketed |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₁H₁₉N₃O |
|
CCCCC1=C(NC(=NC1=O)NCC)C |
|
No data |
|
BBXXLROWFHWFQY-UHFFFAOYSA-N |
|
InChI=1S/C11H19N3O/c1-4-6-7-9-8(3)13-11(12-5-2)14-10(9)15/h4-7H2,1-3H3,(H2,12,13,14,15) |
|
Yes |
|
Fungicide, Metabolite |
|
Soil, Sediment, Surface water |
|
Pyrimidine fungicide |
|
>97% |
|
- |
|
Synthetic |
|
Systemic, absorbed by roots and translocated. Inhibits nucleic acid synthesis (adenosine deaminase). |
|
23947-60-6 |
|
245-949-3 |
|
242 |
|
228900 |
|
32152 |
|
603-086-00-3 |
|
209.29 |
|
5-butyl-2-(ethylamino)-6-methylpyrimidin-4-ol |
|
5-butyl-2-ethylamino-6-methylpyrimidin-4-ol |
|
5-butyl-2-(ethylamino)-6-methyl-4(1H)-pyrimidinone |
|
PAN listed Highly Hazardous Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
8 |
|
- |
|
Colourless crystals |
|
|
|
- Zeneca
- Syngenta
- ICI Plant Protection
|
|
- Milcurb Super
- Milgo
- Ferrax
- Milcap
|
|
Available in a variety of formulations including emulsifiable concentrates and soluble concentrates |
|
|
|
|
|
|
|
233 |
|
Moderate |
|
- |
- |
- |
|
159 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.00 X 1002 |
Calculated |
- |
|
2.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.21 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Weak base |
|
0.267 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility. If applied directly to plants, drift is a concern & mitigation is advisable |
|
2.00 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
77 |
T4 T = UN EPFA database. Dataset no longer available. 4 = Verified data |
Moderately persistent |
|
53 |
|
Moderately persistent |
|
20 |
|
Non-persistent |
|
177 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
EU dosssier (for bupirimate) lab studies DT₅₀ range 19-114 days, DT₉₀ range 63-379 days; field studies DT₅₀ range 13-39 daysT |
|
|
- |
- |
- |
|
- |
|
|
3.5 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Cucumber fruit, undercover, n=1 |
|
|
- |
- |
- |
|
- |
|
|
30 |
|
Moderately persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
10.0 |
|
Moderately mobile |
|
402 |
|
0.849 |
|
EU dossier (for bupirimate) Kf range 1.8-33.0 mL g⁻¹, kfoc range 97-950 mL g⁻¹, 1/n range 0.808-0.883, Soils=4 |
|
No |
|
|
|
|
|
1.82 |
Calculated |
Transition state |
|
|
5.09 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
Low risk |
Based on LogP < 3 |
Low risk |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 4000 |
Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 yr |
- |
|
> 200 |
- |
|
- |
- |
- |
|
> 3000 |
Perdix perdix |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida corr |
Low |
|
7.3 |
Eisenia foetida corr |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
81.0 |
Folsomia candida corr |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
1.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Harmless |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
60.8 |
Oncorhynchus mykiss |
Moderate |
|
>= 41.4 |
Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
50.0 |
Daphnia magna |
Moderate |
|
7.3 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
24 |
Pseudokirchneriella subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 4000 |
Rat |
Low |
|
2000 |
Rat |
- |
|
4.9 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
Not explected to auto-ignite, Not highly flammable |
|
Health: H312 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
- |
|
- |
|
- |
|
|
|
ethirimol |
|
ethyrimol |
|
Ethirimol |
|
ethirimol |
|
etirimol |
|
etirimol |
|
ethirimol |
|
etyrymol |
|
- |
|
- |
|
ethirimol |
|
- |
Record last updated: |
13/09/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |