Etrimfos |
![]() Last updated: 27/11/2019 |
![]() |
(Also known as: etrimphos) |
|
![]() |
|
An obsolete insecticide once used to control various chewing pests of various crops and stored grain | |
---|---|---|
|
Caterpillars; Stem borers, Scale; Leatherjackets; Colorado beetles; Moths; Corn-borers; Weevils | |
|
Top fruit; Citrus; Vines; Olives; Vegetables including Brussel sprouts, cabbages, broccoli, calabrese; Cereals; Rice | |
|
- | |
|
Obsolete | |
|
1975, first reported |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
UK | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₀H₁₇N₂OPS | |
|
CCC1=NC(=CC(=N1)OP(=S)(OC)OC)OCC | |
|
No data | |
|
FGIWFCGDPUIBEZ-UHFFFAOYSA-N | |
|
InChI=1S/C10H17N2O4PS/c1-5-8-11-9(15-6-2)7-10(12-8)16-17(18,13-3)14-4/h7H,5-6H2,1-4H3 | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Organophosphate | |
|
- | |
|
- | |
|
Synthetic | |
|
Contact and stomach action, non-systemic. Acetylcholinesterase inhibitor. | |
|
38260-54-7 | |
|
253-855-9 | |
|
379 | |
|
427500 | |
|
37995 | |
|
292.29 | |
|
O-(6-ethoxy-2-ethylpyrimidin-4-yl) O,O-dimethyl phosphorothioate | |
|
O-6-ethoxy-2-ethylpyrimidin-4-yl O,O-dimethyl phosphorothioate | |
|
O-(6-ethoxy-2-ethyl-4-pyrimidinyl) O,O-dimethyl phosphorothioate | |
|
May be phytoxoic to some top fruit | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1B | |
|
Not applicable | |
|
Culex pipiens pipiens | |
|
Colourless oily liquid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Available in a variety of formulations including emuslfiable concentrates, granules and dips. |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
40 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Low | ||||||||
|
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Chloroform3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Xylene3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | |||||||||
|
-3.4 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
8.71 X 1002 | Calculated | - | |||||||
|
2.94 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
Moderate | ||||||||
|
1.25 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
6.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile | ||||||||
|
6.30 X 10-02 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
12.5 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature DT₅₀ range 8-17 days (R3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
26 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Non-persistent | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | P3 P = Other governments and regulators 3 = Unverified data of known source |
Mobile | |||||||
|
70 | ||||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
2.36 | Calculated | Transition state | ||||||||||||||||||||||||||
|
|
6.98 X 10-02 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | 0.850 | Major fraction, Relevant |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
336 | P4 P = Other governments and regulators 4 = Verified data |
Threshold for concern | |||||||
|
Not available | - | |||||||||
|
> 1800 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
740 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.024 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
0.0173 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
High | ||||||||
|
0.0001 | P4 P = Other governments and regulators Daphnia magna4 = Verified data |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
2.9 | K3 K = Research datasets, e.g. Pandora, Demetra Scenedesmus subspicatus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
0.1 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
High | |||||||
|
- | - | - | ||||||||
|
Toxic | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Toxic | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
Harmful | [Dose: 620 g ha⁻¹] AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Typhlodromus pyri3 = Unverified data of known source |
- | |||
|
|
- | - | - |
|
Harmful | [Dose: 620 g ha⁻¹] AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Chrysoperla carnea3 = Unverified data of known source |
- | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 1800 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.003 | F3 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) JMPR 19863 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Moderately toxic |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Not compatible with strong alkaline substances | |||
|
Health: H302 Environment: H400, H410 |
|||
|
Xn - Harmful: R22 N - Dangerous for the environment: R50, R51 |
|||
|
S2, S60, S61 | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
etrimfos | ||
|
etrimphos | ||
|
Etrimfos | ||
|
etrimfos | ||
|
etrimfos | ||
|
etrimfos | ||
|
etrimfos | ||
|
etrymfos | ||
|
- | ||
|
etrimfosz | ||
|
etrimfos |
Record last updated: | 27/11/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |