Amidoflumet (Ref: S-1955) |
![]() Last updated: 14/01/2021 |
![]() |
(Not known by any other names) |
SUMMARY |
Amidoflumet is a public health insect not approved for use in most of the developed world. Little is know about its chemical properties, environmental fate nor its toxicity to humans or biodiversity. |
|
![]() |
|
A trifluoromethanesulfonanilide amenity insecticide used to control house dust mite and other insect pests. | |
---|---|---|
|
House dust mite; Cockroaches; Houseflies | |
|
Domestic households; Public buildings | |
|
- | |
|
Current | |
|
2004 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Japan |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₉H₇ClF₃NO₄S | |
|
COC(=O)C1=C(C=CC(=C1)Cl)NS(=O)(=O)C(F)(F)F | |
|
No data | |
|
KBHDSWIXRODKSZ-UHFFFAOYSA-N | |
|
InChI=1S/C9H7ClF3NO4S/c1-18-8(15)6-4-5(10)2-3-7(6)14-19(16,17)9(11,12)13/h2-4,14H,1H3 | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
amidoflumet | - | ![]() |
General status |
|
Insecticide, Acaricide | |
---|---|---|
|
Unclassified | |
|
- | |
|
- | |
|
Synthetic | |
|
Unknown mechanism, fast action | |
|
84466-05-7 | |
|
- | |
|
- | |
|
- | |
|
9861780 | |
|
317.66 | |
|
methyl 5-chloro-2-(1,1,1-trifluoromethanesulfonamido)benzoate | |
|
methyl 5-chloro-2-(((trifluoromethyl)sulfonyl)amino)benzoate | |
|
methyl 5-chloro-2-(((trifluoromethyl)sulfonyl)amino)benzoate | |
|
Marine pollutant | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not known | |
|
Not applicable | |
|
- | |
|
Slightly yellow or colorless crystalline solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
81 | R4 R = Peer reviewed scientific publications 4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.35 X 1002 | Calculated | - | |||||||
|
2.13 | R3 R = Peer reviewed scientific publications at pH 5 24 °C3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
3.8 | - | - | ||||||||
- | |||||||||||
|
0.000051 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
200 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
6.0 | R3 R = Peer reviewed scientific publications Cyprinus carpiokoi 48 hr3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
200 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
Moderate | ||||||||
|
2000 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
- | ||||||||
|
5.44 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Exposure may cause decreases in spontaneous activity, ataxic gait and irregular respiration Possible liver toxicant |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG Transport Code is 6.1 | |||
|
Health: H301 Environment: H411 |
|||
|
- | |||
|
- | |||
|
- | |||
|
- | |||
|
Packaging Group III (minor danger) |
|
![]() |
|
|
||
---|---|---|---|
|
amidoflumet | ||
|
amidoflumet | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 14/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |