Cyhalodiamide (Ref: ZJ4042) |
![]() Last updated: 05/01/2021 |
![]() |
(Also known as: lüfuqingchongxianan) |
|
![]() |
|
A novel insecticide used largely to protect rice crops from Lepidoptera pests | |
---|---|---|
|
Cnaphalocrocis medinalis, Chilo suppressalis, Pieris rapae, Plutella xylostella, Helicoverpa armigera | |
|
Rice; Cotton; vegetables; Tea; Tobacco; Fruit | |
|
Shown to be highly effective against Lepidoptera pests in field trails | |
|
Current | |
|
- |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
China |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₂₂H₁₇ClF₇N₃O₂ | |
|
CC1=C(C=CC(=C1)C(C(F)(F)F)(C(F)(F)F)F)NC(=O)C2=C(C(=CC=C2)Cl)C(=O)NC(C)(C)C#N | |
|
- | |
|
NNRSYETYEADPBW-UHFFFAOYSA-N | |
|
InChI=1S/C22H17ClF7N3O2/c1-11-9-12(20(24,21(25,26)27)22(28,29)30)7-8-15(11)32-17(34)13-5-4-6-14(23)16(13)18(35)33-19(2,3)10-31/h4-9H,1-3H3,(H,32,34)(H,33,35) | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Diamide | |
|
- | |
|
- | |
|
Synthetic | |
|
Ryanodine receptor inhibitor, leads to feeding cessation, emesis, hunger, dehydration and death | |
|
1262605-53-7 | |
|
- | |
|
- | |
|
- | |
|
- | |
|
523.84 | |
|
3-chloro-N2-(2-cyanopropan-2-yl)-N1-(4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl)benzene-1,2-dicarboxamide | |
|
3-chloro-N'-(1-cyano-1-methylethyl)-N-(4-(1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl)-o-tolyl)phthalamide | |
|
3-chloro-N2-(1-cyano-1-methylethyl)-N1-(2-methyl-4-(1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl)phenyl)-1,2-benzenedicarboxamide | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
28 | |
|
Not applicable | |
|
- | |
|
Off-white powdery solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
- | |||
|
|
|||
|
Usually supplied as a soluble concentrate |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.28 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Low | ||||||||
|
19870 | R4 R = Peer reviewed scientific publications Ethyl acetate4 = Verified data |
- | ||||||||
4.0 | R4 R = Peer reviewed scientific publications n-Hexane4 = Verified data |
- | |||||||||
2390 | R4 R = Peer reviewed scientific publications Trichloromethane4 = Verified data |
- | |||||||||
39650 | R4 R = Peer reviewed scientific publications Acetone4 = Verified data |
- | |||||||||
|
215.6 | R4 R = Peer reviewed scientific publications 4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
4.90 X 1006 | Calculated | - | |||||||
|
6.69 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
High | ||||||||
|
0.338 | R4 R = Peer reviewed scientific publications 4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
8.77 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Published literature states that the DT₅₀ in paddy soil was 8.77 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
- | |||
|
- | |||
|
- | |||
|
- | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
cyhalodiamide | ||
|
cyhalodiamide | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 05/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |