Mecoprop-P dimethylammonium |

Last updated: 05/02/2025
|
 |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Mecoprop-P dimethylammonium rapidly breaks to mecoprop-P which is a herbicide for post-emergence control of broad-leaved weeds on grass |
|
Cleavers; Chickweed; Clover; Plantains; Ground ivy; Knotweed; Bluegrasses; Bent grass |
|
Lawns; Sports fields; Golf courses; Fairways; Cereals including wheat, barley, oats, triticale |
|
Well established herbicide used across the Europe for broad leaved weed control for many years. |
|
Current |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Ireland |
|
15/05/2025 |
|
No |
|
Yes - as mecoprop-P |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
|
✓ |
✓ |
✓ |
|
|
✓ |
|
|
|
|
|
This substance is the herbicidally active D+ isomer of a variant of chiral mecoprop |
|
C₁₂H₁₈ClNO₃ |
|
CC1=C(C=CC(=C1)Cl)OC(C)C(=O)O.CNC |
|
CC1=C(C=CC(=C1)Cl)O[C@H](C)C(=O)O.CNC |
|
ROGDGDPDLIVQFZ-OGFXRTJISA-N |
|
InChI=1S/C10H11ClO3.C2H7N/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;1-3-2/h3-5,7H,1-2H3,(H,12,13);3H,1-2H3/t7-;/m1./s1 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
Mecoprop |
Parent |
 |
|
Herbicide |
|
Phenoxypropionic herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic, absorbed through leaves and translocated to roots. Synthetic auxin. |
|
66423-09-4 |
|
613-932-3 |
|
475 |
|
- |
|
68515001 |
|
No data found |
|
259.73 |
|
(2R)-2-(4-chloro-2-methylphenoxy)propanoic acid—N-methylmethanamine (1/1) |
|
(R)-2-[(4-chloro-o-tolyl)oxy]propionic acid - dimethylamine (1:1) |
|
(2R)-2-(4-chloro-2-methylphenoxy)propanoic acid compound with N-methylmethanamine (1:1) |
|
- |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Does not dissociate |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Not readily biodegradable |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 930 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 200 |
Apis mellifera as etexyl variant |
Low |
|
> 200 |
Apis mellifera as etexyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
111 |
Oncorhynchus mykiss 4 day |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
200 |
Daphnia magna 2 day NOEL |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.53 |
Lemna gibba 5 day NOEL |
Moderate |
|
- |
- |
- |
|
> 0.26 |
Raphidocelis subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 930 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
2000 |
Rat |
- |
|
4.66 |
Rat |
- |
|
- |
- |
- |
|
0.01 |
as mecoprop-P |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
0.04 |
as mecoprop-P |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
No unacceptable risks to bystanders identified |
|
No unacceptable risks to operators or other workers using PPE/PPC identified |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Excreted mainly via urine - 95% in 24 hrs |
|
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
XNo, known not to cause a problem |
|
|
|
Possible kidney & liver toxicant |
|
|
|
Not expected to auto-ignite, Not highly flammable Not explosive or oxidising IMDG Transport Hazard Class 9 |
|
Health: H302, H317 Environment: H400, H410 |
|
Not listed (Not listed) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
mecoprop-P dimethylammonium |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
05/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |