Flurenol |
![]() Last updated: 28/01/2021 |
![]() |
(Also known as: flurecol) |
|
![]() |
|
A post-emergence plant growth regulator, often used in conjunction with phenoxy herbicides, to assist in the control of broad-leaved weeds | |
---|---|---|
|
Broad-leaved weed control including pineapple weed, bedstraw, hemp nettle | |
|
Cereals including wheat, barley, rye and oats | |
|
- | |
|
Obsolete | |
|
- |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₄H₁₀O₃ | |
|
C1=CC=C2C(=C1)C3=CC=CC=C3C2(C(=O)O)O | |
|
No data | |
|
GXAMYUGOODKVRM-UHFFFAOYSA-N | |
|
InChI=1S/C14H10O3/c15-13(16)14(17)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,17H,(H,15,16) | |
|
Yes |
General status |
|
Plant growth regulator | |
---|---|---|
|
Morphactin | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic, synergist, absorbed by leaves and roots | |
|
467-69-6 | |
|
207-397-1 | |
|
304 | |
|
- | |
|
10087 | |
|
226.23 | |
|
- | |
|
9-hydroxyfluorene-9-carboxylic acid | |
|
9-hydroxy-9H-fluorene-9-carboxylic acid | |
|
Chemical subject to PIC regulations | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
- |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
- | |||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
36.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
1500000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | ||||||||
1450000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
950000 | L3 L = Pesticide manuals and hard copy reference books / other sources Benzene3 = Unverified data of known source |
- | |||||||||
35000 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyclohexane3 = Unverified data of known source |
- | |||||||||
|
71 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
5.01 X 1003 | Calculated | - | |||||||
|
3.7 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.45 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
1.09 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
- | |||||||||||
|
3.10 X 10-02 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
1.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
1 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Moderately fast | |||||||
|
- | ||||||||||
|
|
Stable | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Stable | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
> 6400 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
- | L1 L = Pesticide manuals and hard copy reference books / other sources Rat1 = Estimated data with little or no verification |
- | |||||||
|
10000 | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
318 | L3 L = Pesticide manuals and hard copy reference books / other sources Salmonidae3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
86.7 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
1000 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 6400 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
10000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Environment: H411 | |||
|
N - Dangerous for the environment: R51, R53 | |||
|
S61 | |||
|
U (Unlikely to present an acute hazard) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
flurenol | ||
|
flurenol | ||
|
Flurecol | ||
|
flurecol | ||
|
flurecol | ||
|
flurecol | ||
|
flurenol | ||
|
flurenol | ||
|
- | ||
|
flurenol | ||
|
flurenol |
Record last updated: | 28/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |