Formothion (Ref: SAN 6913I) |
![]() Last updated: 01/02/2021 |
![]() |
(Also known as: ENT 27257; OMS 968; J-38) |
|
![]() |
|
An obsolete systemic, broad spectrum insecticide and acaricide | |
---|---|---|
|
Spider mites; Aphids; Psyllids; Mealy bugs; Whiteflies | |
|
Tree fruit; Vines; Olives; Hops; Cereals; Sugarcane; Rice | |
|
- | |
|
Obsolete | |
|
1961, first reported |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₆H₁₂NO₄PS₂ | |
|
CN(C=O)C(=O)CSP(=S)(OC)OC | |
|
No data | |
|
AIKKULXCBHRFOS-UHFFFAOYSA-N | |
|
InChI=1S/C6H12NO4PS2/c1-7(5-8)6(9)4-14-12(13,10-2)11-3/h5H,4H2,1-3H3 | |
|
Yes |
General status |
|
Insecticide, Acaricide | |
---|---|---|
|
Organophosphate | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic with contact action. Cholinesterase inhibitor. | |
|
2540-82-1 | |
|
219-818-6 | |
|
160 | |
|
366400 | |
|
17345 | |
|
257.27 | |
|
- | |
|
2-dimethoxyphosphinothioylthio-N-formyl-N-methylacetamide | |
|
S-(2-(formylmethylamino)-2-oxoethyl) O,O-dimethyl phosphorodithioate | |
|
Phytotoxic to some varieties of peach, apricot and cherry | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1B | |
|
Not applicable | |
|
Bactrocera dorsalis, Myzus persicae, Rhizoglyphus robini, Tetranychus urticae, Bemisia tabaci, Boophilus microplus, many others | |
|
Yellow viscous liquidy crystals |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually formulated as an emulsifiable concentrate or ULV |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
2600 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
High | ||||||||
|
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Benzene3 = Unverified data of known source |
- | ||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Xylene3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Toluene3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Chloroform3 = Unverified data of known source |
- | |||||||||
|
25 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
3.02 X 1001 | Calculated | - | |||||||
|
1.48 | G4 G = Extension Toxicology network database EXTOXNET (click here ) 4 = Verified data |
Low | ||||||||
|
1.36 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.113 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Low volatility | ||||||||
|
1.11 X 10-05 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
14 | G4 G = Extension Toxicology network database EXTOXNET (click here ) 4 = Verified data |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Literature states that DT₅₀ is between 0.5 - 15 days. Loamy soil <1 day. | ||||||||||
|
|
1.2 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- | |||||||
|
Green bean leaves, n=1 | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
0.17 | K3 K = Research datasets, e.g. Pandora, Demetra 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | P3 P = Other governments and regulators 3 = Unverified data of known source |
Mobile | |||||||
|
21 | ||||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.07 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
1.64 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | 0.700 | Major fraction, Relevant |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
0.07 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
Low potential | |||||||
|
Not available | - | |||||||||
|
> 365 | G4 G = Extension Toxicology network database EXTOXNET (click here ) Rat4 = Verified data |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
630 | G3 G = Extension Toxicology network database EXTOXNET (click here ) Columbidae3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
38.3 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
16.1 | W3 W = French database provided by ARVALIS-Institut du Végétal Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
42.3 | L3 L = Pesticide manuals and hard copy reference books / other sources Scenedesmus subspicatus3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
0.15 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
High | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
157.7 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 365 | G4 G = Extension Toxicology network database EXTOXNET (click here ) Rat4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
May cause blurred vision, muscle spasms or loss of coordination |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Incompatible with alkaline substances | |||
|
Health: H302, H312 | |||
|
Xn - Harmful: R21/22 | |||
|
S2, S36/37 | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
formothion | ||
|
formothion | ||
|
Formothion | ||
|
formothion | ||
|
formothion | ||
|
formotion | ||
|
formothion | ||
|
formotion | ||
|
- | ||
|
- | ||
|
formothion |
Record last updated: | 01/02/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |