Sodium hexafluorosilicate (Ref: ENT 1501) |

Last updated: 12/01/2024
|
 |
(Also known as: sodium silicofluoride; sodium fluorosilicate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Sodium hexafluorosilicate was once used as a granular insecticide and rodenticide but now considered obsolate. It is now mainly used as a drinking water fluoridation agent and has veterinary medicine applications. |
|
Weevils; Cockroaches; Earwigs; Rats; Mice |
|
Residential pest control; Livestock |
|
- |
|
Considered obsolete but may be available in some countries |
|
late 1940s, introduced |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
Na₂SiF₆ |
|
F[Si-2](F)(F)(F)(F)F.[Na+].[Na+] |
|
- |
|
TWGUZEUZLCYTCG-UHFFFAOYSA-N |
|
InChI=1S/F6Si.2Na/c1-7(2,3,4,5)6;;/q-2;2*+1 |
|
Yes |
|
Insecticide, Veterinary substance |
|
Inorganic insecticide |
|
- |
|
- |
|
Synthetic |
|
- |
|
16893-85-9 |
|
240-934-8 |
|
- |
|
- |
|
28127 |
|
009-012-00-0 |
|
188.06 |
|
disodium hexafluorosilicate(2−) |
|
disodium;hexafluorosilicon(2-) |
|
disodium hexafluorosilicate(2−) |
|
Phytotoxic |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
White crystalline solid |
|
|
|
- |
|
- |
|
Often used as granular baits |
|
|
|
|
|
72000 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
High |
|
- |
- |
- |
|
Decomposes on melting |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Decomposes before boiling |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
500 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
2.68 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
< 70 |
R4 R = Peer reviewed scientific publications 4 = Verified data Mouse |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
< 70 |
R4 R = Peer reviewed scientific publications 4 = Verified data Mouse |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Substance is largely absorbed with around 30% eliminated in urine. |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
XNo, known not to cause a problem |
|
|
|
High does may result in respiratory failure, ventricular tachycardia and fibrillation as well as muscle pain and numbness May cause constipation, loss of appetite, paresis of the rumen, severe abdominal pain and diarrhea |
|
|
|
When heated to decomposition, sodium hexafluorosilicate releases toxic fumes of hydrogen |
|
Health: H301, H311 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
UN2674 |
|
- |
|
- |
|
|
|
sodium hexafluorosilicate |
|
fluorosilicate de sodium |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
12/01/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |