Furalaxyl (Ref: IPE 134) |
![]() Last updated: 31/10/2018 |
![]() |
(Also known as: CGA 38140) |
|
![]() |
|
A fungicide used to control diseases cause by phycomycetes especially in ornamental plants | |
---|---|---|
|
phycomycetes> | |
|
Ornamentals; Flowers | |
|
- | |
|
Current | |
|
1977, first reported |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Australia |
---|
Chemical structure |
|
A chiral molecule | |
---|---|---|
|
C₁₇H₁₉NO₄ | |
|
CC1=C(C(=CC=C1)C)N(C(C)C(=O)OC)C(=O)C2=CC=CO2 | |
|
No data | |
|
CIEXPHRYOLIQQD-UHFFFAOYSA-N | |
|
InChI=1S/C17H19NO4/c1-11-7-5-8-12(2)15(11)18(13(3)17(20)21-4)16(19)14-9-6-10-22-14/h5-10,13H,1-4H3 | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
furalaxyl | Unstated isomer | ![]() |
General status |
|
Fungicide | |
---|---|---|
|
Acylalanine | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic with protective and curative action. Disrupts fungal nucleic acid synthesis - RNA ploymerase 1 | |
|
57646-30-7 | |
|
260-875-1 | |
|
433 | |
|
- | |
|
42504 | |
|
301.34 | |
|
- | |
|
methyl N-(2-furoyl)-N-(2,6-xylyl)-DL-alaninate | |
|
methyl N-(2,6-dimethylphenyl)-N-(2-furanylcarbonyl)-DL-alaninate | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
4 | |
|
- | |
|
White crystals | |
|
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as wettable powder or as granules |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
230 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
600000 | L3 L = Pesticide manuals and hard copy reference books / other sources Dichloromethane3 = Unverified data of known source |
- | ||||||||
520000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
500000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | |||||||||
4000 | L3 L = Pesticide manuals and hard copy reference books / other sources Hexane3 = Unverified data of known source |
- | |||||||||
|
102 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
5.01 X 1002 | Calculated | - | |||||||
|
2.7 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
1.22 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.07 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
9.30 X 10-05 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
48 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature states DT₅₀ 30-65 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
200 | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Persistent | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slightly mobile | |||||||
|
888 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
1.77 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
5.69 X 10-02 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Slightly mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
940 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | |||||||
|
82 | - | |||||||||
|
- | - | - | ||||||||
|
> 6000 | L3 L = Pesticide manuals and hard copy reference books / other sources Coturnix japonica3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
32.5 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
39 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
27 | L3 L = Pesticide manuals and hard copy reference books / other sources Scenedemus subspicatus3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
> 5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
510 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
940 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
3100 | Q3 Q = Miscellaneous internet resources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302 Environment: H412 |
|||
|
Xn - Harmful: R22 N - Dangerous for the environment: R52, R53 |
|||
|
S2, S36/37/39, S61 | |||
|
III (Slightly hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
furalaxyl | ||
|
furalaxyl | ||
|
Furalaxyl | ||
|
furalaxyl | ||
|
furalaxil | ||
|
furalaxil | ||
|
- | ||
|
furalaksyl | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 31/10/2018 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |