Halfenprox (Ref: MTI 732) |
![]() Last updated: 05/01/2021 |
![]() |
(Also known as: brofenprox; fubfenprox) |
|
![]() |
|
An insecticide and acaricide used to control mites and other insects in vegetables and fruit | |
---|---|---|
|
Mites and their eggs | |
|
Fruit including pears, papayas, citrus; Tea | |
|
- | |
|
Current | |
|
1994, Japan |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₂₄H₂₃BrF₂O₃ | |
|
CC(C)(COCC1=CC(=CC=C1)OC2=CC=CC=C2)C3=CC=C(C=C3)OC(F)(F)Br | |
|
No data | |
|
WIFXJBMOTMKRMM-UHFFFAOYSA-N | |
|
InChI=1S/C24H23BrF2O3/c1-23(2,19-11-13-21(14-12-19)30-24(25,26)27)17-28-16-18-7-6-10-22(15-18)29-20-8-4-3-5-9-20/h3-15H,16-17H2,1-2H3 | |
|
Yes |
General status |
|
Insecticide, Acaricide | |
---|---|---|
|
Pyrethroid | |
|
- | |
|
- | |
|
Synthetic | |
|
Broad spectrum with contact knock-down action and some residual effects. Sodium channel modulator. | |
|
111872-58-3 | |
|
- | |
|
None allocated | |
|
- | |
|
10140464 | |
|
477.34 | |
|
- | |
|
2-(4-bromodifluoromethoxyphenyl)-2-methylpropyl 3-phenoxybenzyl ether | |
|
1-[[2-[4-(bromodifluoromethoxy)phenyl]-2-methylpropoxy]methyl]-3-phenoxybenzene | |
|
PAN listed Highly Hazardous Chemical | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
3A | |
|
Not applicable | |
|
None identified | |
|
Colourless liquid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
- | |||
|
Usually supplied as an emulsifiable concentrate or concentrated solution. |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.00005 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
600000 | L3 L = Pesticide manuals and hard copy reference books / other sources Hexane3 = Unverified data of known source |
- | ||||||||
585000 | L3 L = Pesticide manuals and hard copy reference books / other sources Heptane3 = Unverified data of known source |
- | |||||||||
560000 | L3 L = Pesticide manuals and hard copy reference books / other sources Xylene3 = Unverified data of known source |
- | |||||||||
513000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
|
- | - | - | ||||||||
|
Decomposes before boiling | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
291.2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
272 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
5.01 X 1007 | Calculated | - | |||||||
|
7.7 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.32 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
7.79 X 10-04 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
7.44 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
10 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
4 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately fast | |||||||
|
- | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
Stable pH 5 to pH 7, DT₅₀ 230 days at pH 9, all at 25 °C | ||||||||||
|
1 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Fast | ||||||||
|
1 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderately fast |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
132 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 1884 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.0035 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyprinidae3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
0.000031 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
27000 | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Low | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
218 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
132 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Potent brain toxicant |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H301 Environment: H400, H410 |
|||
|
T - Toxic: R25 N - Dangerous for the environment: R50/53 |
|||
|
S45, S60, S61 | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
halfenprox | ||
|
halfenprox | ||
|
Halfenprox | ||
|
halfenprox | ||
|
halfenprox (alias brofenprox) | ||
|
halfenprox | ||
|
- | ||
|
halfenproks | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 05/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |