1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |

Last updated: 28/10/2024
|
 |
(Also known as: DMDM hydantoin) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An antimicrobial formaldehyde releaser preservative which is highly efficacious against gram-negative, gram-positive bacteria and moulds. |
|
Current |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₇H₁₂N₂O₄ |
|
CC1(C(=O)N(C(=O)N1CO)CO)C |
|
- |
|
WSDISUOETYTPRL-UHFFFAOYSA-N |
|
InChI=1S/C7H12N2O4/c1-7(2)5(12)8(3-10)6(13)9(7)4-11/h10-11H,3-4H2,1-2H3 |
|
Yes |
|
Other substance |
|
Biocide, Preservative, Disinfectant, Algicide, Antimicrobial |
|
Hydantoin susbstance |
|
- |
|
May contain ~3% monomethyloldimethylhydantoin or other dimethylhydantoin formaldehyde products |
|
Synthetic |
|
Slowly releases formaldehyde and works as a preservative by making the environment less favorable to microorganisms |
|
6440-58-0 |
|
229-222-8 |
|
- |
|
- |
|
22947 |
|
188.18 |
|
1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
|
1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
|
1,2-dimethylol-5,6-dimethylhydantoine |
|
Regulated under (EC) 2009/1223 on the manufacturing and labeling of cosmetic products; Registered under REACH |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Odourless white, crystalline substance |
|
|
|
|
|
1773000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
High |
|
1075000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Methanol |
- |
202000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Acetone |
- |
564000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Ethanol |
- |
20000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Hexane |
- |
|
90 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Decomposes on boiling |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 3700 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
> 3700 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat |
Low |
|
2000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Some metabolism - parent and metabolites are excreted primarily via the urine |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
XNo, known not to cause a problem |
|
|
|
May cause contact dermatitis Formaldehyde is considered carcinogenic Skin hyperreactive |
|
|
|
No information available |
|
Health: H302 |
|
- |
|
- |
|
- |
|
- |
|
|
|
1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
28/10/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |