Imazamethabenz-methyl (Ref: AC 222293) |
![]() Last updated: 11/02/2021 |
![]() |
(Also known as: imazamethabenz, methyl variant; CL 222293) |
|
![]() |
|
A post-emergence herbicide for use in winter cereals and other crops to control grasses and some dicotyledonous weeds | |
---|---|---|
|
Grasses and some dicotyledonous weeds | |
|
Sunflowers; Wheat; Barley | |
|
- | |
|
Current | |
|
1982, first reported; 1998, first registered 1988 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
UK | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
USA |
---|
Chemical structure |
|
A chiral molecule | |
---|---|---|
|
C₁₆H₂₀N₂O₃ | |
|
COC(=O)c1ccc(C)cc1C2=NC(C)(C(C)C)C(=O)N2.COC(=O)c3cc(C)ccc3C4=NC(C)(C(C)C)C(=O)N4 | |
|
No data | |
|
WXUNXXKSYBUHMK-UHFFFAOYSA-N | |
|
InChI=1S/C16H20N2O3/c1-9(2)16(4)15(20)17-13(18-16)12-8-10(3)6-7-11(12)14(19)21-5/h6-9H,1-5H3,(H,17,18,20) | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Imidazolinone | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, systemic absorbed through roots and leaves. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. | |
|
81405-85-8 | |
|
- | |
|
529 | |
|
128842 | |
|
54744 | |
|
288.3 | |
|
- | |
|
mix of methyl 6-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-m-toluate and methyl 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-p-toluate | |
|
methyl 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-4(or 5)-methylbenzoate | |
|
- | |
|
- | |
|
B | |
|
2 | |
|
Not applicable | |
|
Not applicable | |
|
Avena fatua, Alopecurus myosuroides | |
|
Off-white powder |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as a liquid concentrate or as soluble granules. |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
1114 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
High | ||||||||
|
291000 | C4 C = AGRITOX (click here ) Acetone4 = Verified data |
- | ||||||||
135000 | C4 C = AGRITOX (click here ) Chloroform4 = Verified data |
- | |||||||||
57500 | C4 C = AGRITOX (click here ) Xylene4 = Verified data |
- | |||||||||
400 | L3 L = Pesticide manuals and hard copy reference books / other sources n-Hexane3 = Unverified data of known source |
- | |||||||||
|
131 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
93 | L3 L = Pesticide manuals and hard copy reference books / other sources (closed cup)3 = Unverified data of known source |
- | ||||||||
|
|
3.47 X 1001 | Calculated | - | |||||||
|
1.54 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Low | ||||||||
|
0.3 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
2.9 | DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. MS in preparation 4 = Verified data |
- | ||||||||
Strong acid | |||||||||||
|
1.50 X 10-03 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
5.05 X 10-07 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
47 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderately persistent | |||||||
|
47 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderately persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature DT₅₀ range 45-57 days (R3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
36 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Stable | |||||||
|
- | ||||||||||
|
|
133 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Persistent | |||||||
|
Slow at pH 5 to pH7, rapid at pH 9 | ||||||||||
|
- | - | - | ||||||||
|
7 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderately fast |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | H3 H = The US ARS pesticide properties database (click here ) 3 = Unverified data of known source |
Mobile | |||||||
|
35 | ||||||||||
|
Other sources: 51 mL g⁻¹ (DW3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
4.11 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
1.21 X 1000 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
12.5 | L2 L = Pesticide manuals and hard copy reference books / other sources Rat 2 year2 = Unverified data of unknown source |
High | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 2150 | L3 L = Pesticide manuals and hard copy reference books / other sources Anas platyrhynchos3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 100 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
> 220 | J4 J = Pesticide Action Network database (click here ) Daphnia magna4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
78.1 | F4 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) Pseudokirchneriella subcapitata4 = Verified data |
Low | ||||||||
|
50 | Q2 Q = Miscellaneous internet resources Unknown species2 = Unverified data of unknown source |
Low | ||||||||
|
|
- | - | - | |||||||
|
> 100 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
> 123 | L3 L = Pesticide manuals and hard copy reference books / other sources Eisenia foetida3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rabbit3 = Unverified data of known source |
- | ||||||||
|
5.8 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.0625 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
May cause irreversible eye damage |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Prevent generation of mists Corrosive |
|||
|
Not classified: Obsolete | |||
|
Xi - Irritant: R36 N - Dangerous for the environment: R50 |
|||
|
- | |||
|
U (Unlikely to present an acute hazard) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
imazamethabenz-methyl | ||
|
imazamethabenz | ||
|
Imazamethabenz-methyl | ||
|
imazamethabenz-methyl | ||
|
imazamethabenz | ||
|
imazametabenz-metil | ||
|
- | ||
|
imazametabenz metylu | ||
|
- | ||
|
- | ||
|
imazamethabenzmethyl |
Record last updated: | 11/02/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |