Mefenacet (Ref: FOE 1976) |
![]() Last updated: 18/02/2021 |
![]() |
(Also known as: NTN 801) |
|
![]() |
|
A herbicide used for pre- and early post-emergence control of weeds mainly in rice crops | |
---|---|---|
|
Grass weeds particularly Barnyard grass | |
|
Transplanted rice; Cereals; Legumes; Vegetables; Fruit; Hops | |
|
- | |
|
Unknown | |
|
1987, Japan |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₆H₁₄N₂O₂S | |
|
CN(C1=CC=CC=C1)C(=O)COC2=NC3=CC=CC=C3S2 | |
|
No data | |
|
XIGAUIHYSDTJHW-UHFFFAOYSA-N | |
|
InChI=1S/C16H14N2O2S/c1-18(12-7-3-2-4-8-12)15(19)11-20-16-17-13-9-5-6-10-14(13)21-16/h2-10H,11H2,1H3 | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
mefenacet | - | ![]() |
General status |
|
Herbicide | |
---|---|---|
|
Oxyacetamide | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, inhibits cell division and growth. Inhibition of VLCFA (inhibition of cell division). | |
|
73250-68-7 | |
|
277-328-8 | |
|
8206 | |
|
- | |
|
91716 | |
|
298.36 | |
|
- | |
|
2-(1,3-benzothiazol-2-yloxy)-N-methylacetanilide | |
|
2-(2-benzothiazolyloxy)-N-methyl-N-phenylacetamide | |
|
- | |
|
- | |
|
K3 | |
|
15 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Colourless crystals |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as granules and wettable powders |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
4 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
200000 | L3 L = Pesticide manuals and hard copy reference books / other sources Dichloromethane3 = Unverified data of known source |
- | ||||||||
500 | L2 L = Pesticide manuals and hard copy reference books / other sources Hexane2 = Unverified data of unknown source |
- | |||||||||
35000 | L2 L = Pesticide manuals and hard copy reference books / other sources Toluene2 = Unverified data of unknown source |
- | |||||||||
7500 | L2 L = Pesticide manuals and hard copy reference books / other sources Isopropanol2 = Unverified data of unknown source |
- | |||||||||
|
134.8 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.70 X 1003 | Calculated | - | |||||||
|
3.23 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.32 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
6.40 X 10-04 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
4.77 X 10-05 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
35 | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
Stable pH 4 to pH 9 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slightly mobile | |||||||
|
2964 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.82 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
1.53 X 10-02 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Slightly mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | - | - | |||||
|
Soil | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
29 | R4 R = Peer reviewed scientific publications (whole body)4 = Verified data |
Low potential | |||||||
|
Not available | - | |||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
- | L2 L = Pesticide manuals and hard copy reference books / other sources Rat 2 year2 = Unverified data of unknown source |
- | |||||||
|
100 | - | |||||||||
|
- | - | - | ||||||||
|
5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
6 | L3 L = Pesticide manuals and hard copy reference books / other sources Salmonidae3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
1.81 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
0.18 | L3 L = Pesticide manuals and hard copy reference books / other sources Scenedemus subspicatus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
1000 | L3 L = Pesticide manuals and hard copy reference books / other sources Eisenia foetida3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
0.02 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat (dust)3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.0036 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Environment: H411 | |||
|
N - Dangerous for the environment: R51, R53 | |||
|
S61 | |||
|
U (Unlikely to present an acute hazard) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
mefenacet | ||
|
mefenacet | ||
|
Mefenacet | ||
|
mefenacet | ||
|
mefenacet | ||
|
mefenacet | ||
|
- | ||
|
mefenacet | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 18/02/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |