Nuarimol (Ref: EL 228) |
![]() Last updated: 27/11/2019 |
![]() |
(Also known as: triminol) |
|
![]() |
|
A fungicide used to control a wide range of pathogenic fungi including Pseudocercosporella spp. and Septoria spp. | |
---|---|---|
|
Powdery mildews; Leaf spot | |
|
Fruit including pome and stone; Vines; Curcubits; Cereals | |
|
- | |
|
Obsolete | |
|
1980 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
A chiral molecule. The technical material is a racemate equimolar mixture of the pair of enantiomers. | |
---|---|---|
|
C₁₇H₁₂ClFN₂O | |
|
C1=CC=C(C(=C1)C(C2=CC=C(C=C2)F)(C3=CN=CN=C3)O)Cl | |
|
No data | |
|
SAPGTCDSBGMXCD-UHFFFAOYSA-N | |
|
InChI=1S/C17H12ClFN2O/c18-16-4-2-1-3-15(16)17(22,13-9-20-11-21-10-13)12-5-7-14(19)8-6-12/h1-11,22H | |
|
Yes |
General status |
|
Fungicide | |
---|---|---|
|
Pyrimidine | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic with curative and protective action. Sterol demethylation (ergosterol biosynthesis) inhibitor. | |
|
63284-71-9 | |
|
264-071-1 | |
|
443 | |
|
224100 | |
|
91683 | |
|
314.7 | |
|
- | |
|
(RS)-2-chloro-4'-fluoro-α-(pyrimidin-5-yl)benzhydryl alcohol | |
|
α-(2-chlorophenyl)-α-(4-fluorophenyl)-5-pyrimidinemethanol | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
3 | |
|
- | |
|
Colourless crystals |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as an emulsifiable concentrate or seed treatment |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
26 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Low | ||||||||
|
170000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
55000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | |||||||||
20000 | L3 L = Pesticide manuals and hard copy reference books / other sources Xylene3 = Unverified data of known source |
- | |||||||||
|
126.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.51 X 1003 | Calculated | - | |||||||
|
3.18 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
High | ||||||||
|
0.7 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.0027 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Low volatility | ||||||||
|
3.27 X 10-05 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
150 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent | |||||||
|
344 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent | ||||||||
|
150 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
0.04 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Fast | |||||||
|
- | ||||||||||
|
|
64 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderately persistent | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | W3 W = French database provided by ARVALIS-Institut du Végétal 3 = Unverified data of known source |
Moderately mobile | |||||||
|
241 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.52 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
6.77 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Moderately mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
1250 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | L2 L = Pesticide manuals and hard copy reference books / other sources Rat 2 year2 = Unverified data of unknown source |
- | |||||||
|
50 | - | |||||||||
|
- | - | - | ||||||||
|
> 200 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 12.1 | L3 L = Pesticide manuals and hard copy reference books / other sources Lepomis macrochirus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
> 25 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
2.5 | L2 L = Pesticide manuals and hard copy reference books / other sources Unknown species2 = Unverified data of unknown source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
21.6 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderate | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
100000 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
Harmless | AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Typhlodromus pyri2 = Unverified data of unknown source |
- | |||
|
|
- | - | - |
|
Harmless | AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Chrysoperla carnea2 = Unverified data of unknown source |
- | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
1250 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rabbit3 = Unverified data of known source |
- | ||||||||
|
0.37 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302, H319 | |||
|
Not classified: Obsolete | |||
|
Not classified: Obsolete | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
nuarimol | ||
|
nuarimol | ||
|
Nuarimol | ||
|
nuarimol | ||
|
nuarimol | ||
|
nuarimol | ||
|
- | ||
|
nuarimol | ||
|
- | ||
|
- | ||
|
nuarimol |
Record last updated: | 27/11/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |