Oxadixyl (Ref: SAN 371F) |
![]() Last updated: 03/03/2020 |
![]() |
(Also known as: oxadixil; sandofan; acetamide) |
|
![]() |
|
A fungicide used, in combination with other agents, to control Peronosporales including downy mildew and late blights | |
---|---|---|
|
Downy mildew; Damping-off; Seed rot; Blight; Rust | |
|
Barley; Beets; Vegetables including broccoli, Brussel sprouts, cabbage, carrot, parsnip, peas, pepper; Corn; Cotton; Melon; Turf & lawns | |
|
- | |
|
Current | |
|
1984 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Australia |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₄H₁₈N₂O₄ | |
|
CC1=C(C(=CC=C1)C)N(C(=O)COC)N2CCOC2=O | |
|
No data | |
|
UWVQIROCRJWDKL-UHFFFAOYSA-N | |
|
InChI=1S/C14H18N2O4/c1-10-5-4-6-11(2)13(10)16(12(17)9-19-3)15-7-8-20-14(15)18/h4-6H,7-9H2,1-3H3 | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
oxadixyl | - | ![]() |
General status |
|
Fungicide | |
---|---|---|
|
Phenylamide | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic with curative and protective action. Disrupts fungal nucleic acid synthesis - RNA ploymerase 1. | |
|
77732-09-3 | |
|
- | |
|
397 | |
|
126701 | |
|
53735 | |
|
278.3 | |
|
- | |
|
2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)acet-2',6'-xylidide | |
|
N-(2,6-dimethylphenyl)-2-methoxy-N-(2-oxo-3-oxazolidinyl)acetamide | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
4 | |
|
- | |
|
Colourless crystals | |
|
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually formulated as a wettable powder |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
3400 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
344000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
112000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | |||||||||
50000 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethanol3 = Unverified data of known source |
- | |||||||||
17000 | L3 L = Pesticide manuals and hard copy reference books / other sources Xylene3 = Unverified data of known source |
- | |||||||||
|
104 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
4.47 X 1000 | Calculated | - | |||||||
|
0.65 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
0.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.0033 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
2.70 X 10-07 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
75 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent | |||||||
|
225 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent | ||||||||
|
75 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Lab studies DT₅₀ range 6-9 months, field studies 2-3 months | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Stable | |||||||
|
- | ||||||||||
|
|
Stable | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Stable | |||||||
|
- | ||||||||||
|
21 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Fast | ||||||||
|
25 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slow |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Mobile | |||||||
|
36 | ||||||||||
|
Literature values range 24-50 mL g⁻¹ | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
4.58 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
2.49 X 1000 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
0.8 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low potential | |||||||
|
Not available | - | |||||||||
|
1860 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
19.7 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
High | |||||||
|
250 | - | |||||||||
|
- | - | - | ||||||||
|
> 2510 | L3 L = Pesticide manuals and hard copy reference books / other sources Anas platyrhynchos3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 300 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyprinidae3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
> 530 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
> 46 | L3 L = Pesticide manuals and hard copy reference books / other sources Scenedemus subspicatus3 = Unverified data of known source |
Low | ||||||||
|
3.06 | P3 P = Other governments and regulators Pseudokirchneriella subcapitata3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
200 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
> 100 | R4 R = Peer reviewed scientific publications Nomia melanderi4 = Verified data |
Low | |||||||
|
Contact | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
1000 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
1860 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
5.6 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Possible liver toxicant USEPA - possible human carcinogen |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302 Environment: H412 |
|||
|
Xn - Harmful: R22 | |||
|
- | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
oxadixyl | ||
|
oxadixyl | ||
|
Oxadixyl | ||
|
oxadixyl | ||
|
oxadixil | ||
|
oxadixil | ||
|
- | ||
|
oksadiksyl | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 03/03/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |