Azocyclotin (Ref: BAY BUE 1452) |

Last updated: 25/09/2024
|
 |
(Also known as: tricyclotin) |
Azocyclotin is an organotin acaricide which is largely considered obsolete. It has a low aqueous solubility, is non-volatile and is not expected to leach to groundwater. Data is limited but is not expected to be persistent in soil systems but may be persistent in aquatic systems under certain conditions. It is highly toxic to mammals and also has a high potential to bioaccumulate. It is thought to be a skin, eye and respiratory system irritant. It is highly toxic to fish and aquatic invertebrates and moderately toxic to birds, honeybees and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An organotin acaricide used mainly for Phytophagous mite control |
|
Mites including spider mites, citrus mites, bulb mites, tomato-russet mite |
|
Fruit including apples, pears, strawberries, grapes, citrus; Egg plant |
|
- |
|
- |
|
1978, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Italy |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Nw Zealand, Chile, Australia, Morocco, South Africa, Iran, Lebanon |
|
None |
|
C₂₀H₃₅N₃Sn |
|
C1CCC(CC1)[Sn](C2CCCCC2)(C3CCCCC3)N4C=NC=N4 |
|
- |
|
ONHBDDJJTDTLIR-UHFFFAOYSA-N |
|
InChI=1S/3C6H11.C2H2N3.Sn/c3*1-2-4-6-5-3-1;1-3-2-5-4-1;/h3*1H,2-6H2;1-2H;/q;;;-1;+1/rC20H35N3Sn/c1-4-10-18(11-5-1)24(23-17-21-16-22-23,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h16-20H,1-15H2 |
|
Yes |
|
Acaricide |
|
Organometal acaricide; Organometal insecticide; Organotin acaricide; Organotin insecticide |
|
- |
|
- |
|
Synthetic |
|
Contact action. Inhibits oxidative phosphorylation. Inhibitor of mitochondrial ATP synthase. |
|
41083-11-8 |
|
255-209-1 |
|
404 |
|
484600 |
|
91634 |
|
050-019-00-3 |
|
436.22 |
|
1-(tricyclohexylstannyl)-1H-1,2,4-triazole |
|
tri(cyclohexyl)-1H-1,2,4-triazol-1-yltin |
|
1-(tricyclohexylstannyl)-1H-1,2,4-triazole |
|
Chemical subject to PIC regulations |
|
- |
|
Not applicable |
|
Not applicable |
|
12B |
|
Not applicable |
|
Tetranychus urticae |
|
Colourless crystalline powder |
|
|
|
- AgroCare
- King Tech Corp
- Arysta LifeScience Corp
- Bayer
|
|
|
|
Usually supplied as a wettable powder |
|
|
|
|
|
|
|
0.04 |
|
Low |
|
35000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
30 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Isopropanol |
- |
500 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source n-Hexane |
- |
3.5 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Toluene |
- |
|
210 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
|
- |
|
210 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
2.40 X 1005 |
Calculated |
- |
|
5.38 |
T4 T = UN EPFA database. Dataset no longer available. 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.34 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
5.36 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Weak base |
|
1.17 X 10-04 |
|
Low volatility |
|
7.00 X 10-02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
27 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Rapid |
|
Rapid |
|
Complete hydrolysis occurs in under 10 mins at pH 5, 7 and 9 |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Non-mobile |
|
4450 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.50 |
Calculated |
Low leachability |
|
|
9.93 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
7500 |
|
High potential |
|
Not available |
- |
Known groundwater metabolites |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
80 |
Rat |
High |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 yr |
- |
|
5 |
- |
|
- |
- |
- |
|
144 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
806 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Apis mellifera |
Low |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
0.004 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.16 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
80 |
Rat |
High |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
0.02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
0.003 |
|
- |
|
0.02 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
Occupational exposure may occur through inhalation of dust and dermal contact |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Exposure many cause gastric mucosa, haematological changes and hepatotoxicity |
|
|
|
Not expected to auto-ignite; Not highly flammable IMDG Transport Hazard Class 6.1 |
|
Health: H301, H315, H318, H330, H335 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2786 |
|
- |
|
- |
|
|
|
azocyclotin |
|
azocyclotin |
|
Azocyclotin |
|
azocyclotin |
|
azociclotin |
|
azociclotin |
|
- |
|
azocyklocyna |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
25/09/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |