Pirimiphos-ethyl (Ref: PP211) |
![]() Last updated: 24/05/2018 |
![]() |
(Also known as: pyrimiphos-éthyl) |
|
![]() |
|
An obsolete pyrimidine organothiophosphate insecticide once used mainly on top fruit | |
---|---|---|
|
Aphids | |
|
Top fruit including apples, pears; Turf | |
|
- | |
|
Obsolete | |
|
- |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₃H₂₄N₃O₃PS | |
|
CCN(CC)C1=NC(=CC(=N1)OP(=S)(OCC)OCC)C | |
|
No data | |
|
TZBPRYIIJAJUOY-UHFFFAOYSA-N | |
|
InChI=1S/C13H24N3O3PS/c1-6-16(7-2)13-14-11(5)10-12(15-13)19-20(21,17-8-3)18-9-4/h10H,6-9H2,1-5H3 | |
|
Yes |
General status |
|
Insecticide, Acaricide | |
---|---|---|
|
Organophosphate | |
|
>95% | |
|
- | |
|
Synthetic | |
|
Broad-spectrum with contact and respiratory action. Cholinesterase inhibitor. | |
|
23505-41-1 | |
|
245-704-0 | |
|
492 | |
|
108101 | |
|
31957 | |
|
305.34 | |
|
- | |
|
O-2-diethylamino-6-methylpyrimidin-4-yl O,O-diethyl phosphorothioate | |
|
O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl phosphorothioate | |
|
Severe Marine Pollutant | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1B | |
|
Not applicable | |
|
Blissus insularis | |
|
Sraw coloured liquid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Available in a wide variety of different formulations including granules and emulsifiable concentrates |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
93.0 | DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. MS in preparation 4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
15 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
194 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
>60 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
7.08 X 1004 | Calculated | - | |||||||
|
4.85 | P3 P = Other governments and regulators 3 = Unverified data of known source |
High | ||||||||
|
1.14 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.68 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
0.452 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderately volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
45 | M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems) (click here ) 4 = Verified data |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data, literature DT₅₀ studies range 21-70 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | M3 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems) (click here ) 3 = Unverified data of known source |
Moderately mobile | |||||||
|
300 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
2.52 | Calculated | Transition state | ||||||||||||||||||||||||||
|
|
1.55 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Moderately mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3000 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
Threshold for concern | |||||||
|
Not available | - | |||||||||
|
> 140 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
2.5 | L3 L = Pesticide manuals and hard copy reference books / other sources Anas platyrhynchos3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.02 | Q2 Q = Miscellaneous internet resources Salmo trutta2 = Unverified data of unknown source |
High | ||||||||
|
- | - | - | ||||||||
|
0.0025 | Q2 Q = Miscellaneous internet resources Unknown species2 = Unverified data of unknown source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
0.03 | Q2 Q = Miscellaneous internet resources Unknown species2 = Unverified data of unknown source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 140 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
1000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List I; List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Toxic if swallowed |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H301, H312 Environment: H400, H410 |
|||
|
T - Toxic: R25 Xn - Harmful: R25 N - Dangerous for the environment: R50, R53 |
|||
|
S2, S23, S36, S37, S46, S60, S61 | |||
|
Ib (Highly hazardous / Highly hazardous) | |||
|
3018 | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
pirimiphos-ethyl | ||
|
pyrimiphos-ethyl | ||
|
Pirimiphos-ethyl | ||
|
pirimiphos-ethyl | ||
|
pirimifos-etile | ||
|
pirimifos-etil | ||
|
pirimiphos-ethyl | ||
|
pirimifos etylu | ||
|
- | ||
|
- | ||
|
pirimifos-ethyl |
Record last updated: | 24/05/2018 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |