Primisulfuron |
![]() Last updated: 02/03/2021 |
![]() |
(Not known by any other names) |
|
![]() |
|
An urea herbicide used on crop and non-crop areas for the control of grass and many broad-leaved weeds | |
---|---|---|
|
Grasses including Kentucky bluegrass; Broad-leaved weeds | |
|
Corn; Non-cropped areas | |
|
- | |
|
Unknown | |
|
1990 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
None | |
---|---|---|
|
C₁₄H₁₀F₄N₄O₇S | |
|
C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC(F)F)OC(F)F | |
|
No data | |
|
GPGLBXMQFQQXDV-UHFFFAOYSA-N | |
|
InChI=1S/C14H10F4N4O7S/c15-11(16)28-8-5-9(29-12(17)18)20-13(19-8)21-14(25)22-30(26,27)7-4-2-1-3-6(7)10(23)24/h1-5,11-12H,(H,23,24)(H2,19,20,21,22,25) | |
|
Yes |
General status |
|
Herbicide, Metabolite | |
---|---|---|
|
Soil | |
|
Sulfonylurea | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, systemic, absorbed through roots and foliage. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS | |
|
113036-87-6 | |
|
- | |
|
712 | |
|
- | |
|
91774 | |
|
454.31 | |
|
- | |
|
2-[4,6-bis(difluoromethoxy)pyrimidin-2-ylcarbamoylsulfamoyl]benzoic acid | |
|
2-[[[[[4,6-bis(difluoromethoxy)-2-pyrimidinyl]amino]carbonyl]amino]sulfonyl]benzoic acid | |
|
- | |
|
- | |
|
B | |
|
2 | |
|
Not applicable | |
|
Not applicable | |
|
Amaranthus hybridus, Amaranthus rudis, Sorghum bicolor | |
|
Colourless crystalline solid |
Can be a metabolite of: |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
primisulfuron methyl | Soil | - | - |
Formulations |
|
|
|||
---|---|---|---|---|
|
- | |||
|
- | |||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
70 | M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems) (click here ) 4 = Verified data |
Moderate | ||||||||
|
35000 | P4 P = Other governments and regulators Acetone4 = Verified data |
- | ||||||||
1000 | P4 P = Other governments and regulators Ethanol4 = Verified data |
- | |||||||||
570 | P4 P = Other governments and regulators Toluene4 = Verified data |
- | |||||||||
1.5 | P4 P = Other governments and regulators n-Hexane4 = Verified data |
- | |||||||||
|
196.1 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.58 X 1000 | Calculated | - | |||||||
|
0.2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
1.64 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
3.47 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
Weak acid | |||||||||||
|
5.00 X 10-03 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
4.00 X 10-02 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
30 | M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems) (click here ) 4 = Verified data |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
16 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Field studies DT₅₀ range 4-29 days. Other studies DT₅₀ 31–62 days (P3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
248 | P4 P = Other governments and regulators 4 = Verified data |
Stable | |||||||
|
DT₅₀ 20.6 at pH 5, natural sunlight conditions, 30 days | ||||||||||
|
|
Stable | P4 P = Other governments and regulators 4 = Verified data |
Stable | |||||||
|
Stable pH 7 to pH 9, hydrolysis does occur under acidic conditions, DT₅₀ 25 days at pH 5 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | M3 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems) (click here ) 3 = Unverified data of known source |
Mobile | |||||||
|
50 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
2.77 | Calculated | Transition state | ||||||||||||||||||||||||||
|
|
1.40 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
> 5050 | P2 P = Other governments and regulators Rat2 = Unverified data of unknown source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
2150 | P2 P = Other governments and regulators Anas platyrhynchos2 = Unverified data of unknown source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
24 | P2 P = Other governments and regulators Oncorhynchus mykiss2 = Unverified data of unknown source |
Moderate | ||||||||
|
13 | P4 P = Other governments and regulators Oncorhynchus mykiss4 = Verified data |
Low | ||||||||
|
260 | P4 P = Other governments and regulators Daphnia magna4 = Verified data |
Low | ||||||||
|
0.42 | P4 P = Other governments and regulators Daphnia magna4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.8 | P4 P = Other governments and regulators Lemna gibba4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
0.012 | P4 P = Other governments and regulators Pseudokirchneriella subcapitata4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
100 | P4 P = Other governments and regulators 4 = Verified data |
Moderate | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
1000 | P4 P = Other governments and regulators 4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 5050 | P2 P = Other governments and regulators Rat2 = Unverified data of unknown source |
Low | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Mouse3 = Unverified data of known source |
- | ||||||||
|
4.8 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.13 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List II | - | - | ||||||||
|
|
- | |||||||||
|
Occupational exposure may occur through dermal contact | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Possible liver and kidney toxicant at high doses |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Environment: H400, H410 | |||
|
N - Dangerous for the environment: R50/53 | |||
|
None allocated at this time | |||
|
U (Unlikely to present an acute hazard) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
primisulfuron | ||
|
primisulfuron | ||
|
Primisulfuron | ||
|
primisulfuron | ||
|
primisulfuron | ||
|
primisulfuron | ||
|
- | ||
|
primisulfuron | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 02/03/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |