Pyraclofos (Ref: OMS 3040) |
![]() Last updated: 27/11/2019 |
![]() |
(Also known as: TIA 230) |
|
![]() |
|
An insecticide used to control Lepidoptera, Coleoptera, Acarina and nematodes in a range of crops. Is also occassionally used in veterinary medicine as an antiparasitic | |
---|---|---|
|
Blackfly; Mites; Nematodes; Thrips; Corn borer; Budworms; Loopers; Cutworms; Rice weevil | |
|
Tea; Ricve; Cotton; Corn; Potatoes; Soybean; Vegetables | |
|
- | |
|
Unknown | |
|
1989, Japan |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
A molecule with one chiral centre resulting in a pair of enantiomers: S-(+)- and R-(−)-pyraclofos | |
---|---|---|
|
C₁₄H₁₈ClN₂O₃PS | |
|
CCCSP(=O)(OCC)OC1=CN(N=C1)C2=CC=C(C=C2)Cl | |
|
No data | |
|
QHGVXILFMXYDRS-UHFFFAOYSA-N | |
|
InChI=1S/C14H18ClN2O3PS/c1-3-9-22-21(18,19-4-2)20-14-10-16-17(11-14)13-7-5-12(15)6-8-13/h5-8,10-11H,3-4,9H2,1-2H3 | |
|
Yes |
General status |
|
Insecticide, Nematicide, Veterinary substance | |
---|---|---|
|
Organophosphate | |
|
- | |
|
- | |
|
Synthetic | |
|
Respiratory, contact and stomach action. Is an inhibitor of acetylcholinesterase. | |
|
77458-01-6 | |
|
- | |
|
8265 | |
|
- | |
|
93460 | |
|
360.8 | |
|
- | |
|
(RS)-[O-1-(4-chlorophenyl)pyrazol-4-yl O-ethyl S-propyl phosphorothioate] | |
|
O-[1-(4-chlorophenyl)-1H-pyrazol-4-yl] O-ethyl S-propyl phosphorothioate | |
|
Evidence of use in third world countries; PAN listed Highly Hazardous Chemical | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1B | |
|
Not applicable | |
|
- | |
|
Pale yellow oil | |
|
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Available in a variety of formulations including emulsifiable concentrates, granules and wettable powders. |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
33 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Ethanol3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | |||||||||
|
Not applicable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
454 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
5.89 X 1003 | Calculated | - | |||||||
|
3.77 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.271 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
1.60 X 10-03 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
1.75 X 10-05 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
39 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
50 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
29 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slightly mobile | |||||||
|
2095 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
1.15 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
2.47 X 10-02 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Slightly mobile | Calculated | - |
Other known metabolites |
|
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|---|
1-(4-chlorophenyl)pyrazol-4-yl-beta-D-glcopyranoside | - | Plant | - | - | |||||
1-(4-chlorophenyl)pyrazo-4-yl sulfate | - | Rat (Urinary) | 0.7 | - | |||||
desethylpyraclofos | - | Rat (Urinary, Faecal) | - | - | |||||
des-S-propylpyraclofos | - | Rat (Urinary, Faecal) | - | - | |||||
O-ethyl-S-propyl-phosphorothioate | - | Rat (Urinary) | - | - | |||||
monoethylphosphate | - | Rat (Urinary) | - | - | |||||
1-(4-chlorophenyl)pyrazol-4-yl-6-O-malonyl-beta-D-glcopyranoside | - | Plant | 0.51 | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
237 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
0.1 | L2 L = Pesticide manuals and hard copy reference books / other sources Rat 2 year2 = Unverified data of unknown source |
High | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
164 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.028 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyprinidae3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
0.953 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
237 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
1.46 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List I; List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Harmful if swallowed |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG Transport Code is usually 6.1 | |||
|
Health: H301 | |||
|
Xn- Harmful: R22 | |||
|
- | |||
|
II (Moderately hazardous) | |||
|
3018 | |||
|
Packaging Group III (minor danger) |
|
![]() |
|
|
||
---|---|---|---|
|
pyraclofos | ||
|
pyraclofos | ||
|
Pyraclofos | ||
|
pyraclofos | ||
|
piraclofos | ||
|
piraclofos | ||
|
- | ||
|
pyraklofos | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 27/11/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |