Benazolin (Ref: RD 7693) |
![]() Last updated: 31/12/2020 |
![]() |
(Also known as: benazoline) |
SUMMARY |
Benazolin is a post emergence herbicide that does not have EU approval for use. It has a moderate aqueous solubility, is semi-volatile with a high potential to leach to groundwater. It is not persistent in soil systems but may possibly be persistent in water. Benazolin has a low mammalian toxicity and is not expected to bioaccumulation. It has a low to moderate toxicity to most aquatic organisms, honeybees and earthworms. |
|
![]() |
|
A benzothiazolone herbicide for post-emergence control of annual broad-leaved weeds | |
---|---|---|
|
Bedstraw; Chickweed; Bog stitchwort; Stellaria aquatica; Vetch; Shepherd's purse; Wild mustard; Black bindweed; Cleavers | |
|
Cereals especially wheat; Soybeans; Oilseed rape | |
|
- | |
|
Unknown | |
|
1964 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
None | |
---|---|---|
|
C₉H₆ClNO₃S | |
|
C1=CC2=C(C(=C1)Cl)N(C(=O)S2)CC(=O)O | |
|
No data | |
|
HYJSGOXICXYZGS-UHFFFAOYSA-N | |
|
InChI=1S/C11H13NO4/c1-11(2)15-8-6-4-5-7(9(8)16-11)14-10(13)12-3/h4-6H,1-3H3,(H,12,13) | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Benzothiazolone | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, systemic growth-regulation action. Inhibits auxin transport. | |
|
3813-05-6 | |
|
223-297-0 | |
|
136 | |
|
- | |
|
19662 | |
|
243.67 | |
|
(4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid | |
|
4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid | |
|
4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid | |
|
- | |
|
- | |
|
O | |
|
4 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Colourless crystals | |
|
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as an aqueous suspension concentrate of the ethyl ester (50%). |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
500 | B2 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 2 = Unverified data of unknown source |
Moderate | ||||||||
|
110000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
34000 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethanol3 = Unverified data of known source |
- | |||||||||
23000 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethyl acetate3 = Unverified data of known source |
- | |||||||||
580 | L3 L = Pesticide manuals and hard copy reference books / other sources Xylene3 = Unverified data of known source |
- | |||||||||
|
193 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Decomposes before boiling | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
Not expected to self ignite; Not highly flammable | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
- | ||||||||
|
|
2.19 X 1001 | Calculated | - | |||||||
|
1.34 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
1.63 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
3.04 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
Weak acid | |||||||||||
|
1.00 X 10-04 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
4.87 X 10-08 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
21 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
- | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
Stable pH 4 to pH 9 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | S1 S = Expert judgement 1 = Estimated data with little or no verification |
Mobile | |||||||
|
36 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.23 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
2.90 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
36 | P4 P = Other governments and regulators 4 = Verified data |
Low potential | |||||||
|
Not available | - | |||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | |||||||
|
650 | - | |||||||||
|
- | - | - | ||||||||
|
> 10200 | L3 L = Pesticide manuals and hard copy reference books / other sources Coturnix japonica3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 27 | L3 L = Pesticide manuals and hard copy reference books / other sources Lepomis macrochirus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
> 233.4 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
> 16 | L1 L = Pesticide manuals and hard copy reference books / other sources Unknown species1 = Estimated data with little or no verification |
Low | ||||||||
|
1 | Q0 Q = Miscellaneous internet resources Unknown species |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
> 480 | l3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
> 1000 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
1.43 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H315, H319 Environment: H412 |
|||
|
Xi - Irritant: R36/38 N - Dangerous for the environment: R52, R53 |
|||
|
S2, S22, S61 | |||
|
III (Slightly hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
benazolin | ||
|
benazoline | ||
|
Benazolin | ||
|
benazolin | ||
|
benazolin | ||
|
benazolin | ||
|
benazolin | ||
|
benazolina | ||
|
benazolin | ||
|
- | ||
|
benazoline |
Record last updated: | 31/12/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |