Benazolin ethyl |
![]() Last updated: 31/12/2020 |
![]() |
(Also known as: benazolin ethyl ester ; benazolinethyl) |
SUMMARY |
Benazolin ethyl is a post emergence herbicide that does not have EU approval for use. It has a low aqueous solubility, is volatile with a low tendency to leach to groundwater. It is not persistent in soil systems but may be persistent in water. Benazolin ethyl has a low mammalian toxicity and is not expected to bioaccumulation. It has a low toxicity to birds and is moderately toxicity to most aquatic organisms and earthworms. |
|
![]() |
|
A benzothiazolone herbicide for post-emergent control of annual broad-leaved weeds | |
---|---|---|
|
Bedstraw; Chickweed; Bog stitchwort; Stellaria aquatica; Vetch; Shepherd's purse; Wild mustard; Black bindweed; Cleavers | |
|
Cereals especially wheat; Soybeans; Oilseed rape | |
|
- | |
|
Unknown | |
|
- |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₁H₁₀ClNO₃S | |
|
CCOC(=O)CN1C2=C(C=CC=C2Cl)SC1=O | |
|
No data | |
|
WQRCEBAZAUAUQC-UHFFFAOYSA-N | |
|
InChI=1S/C11H10ClNO3S/c1-2-16-9(14)6-13-10-7(12)4-3-5-8(10)17-11(13)15/h3-5H,2,6H2,1H3 | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
benazolin ethyl | - | ![]() |
General status |
|
Herbicide | |
---|---|---|
|
Benzothiazolone | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, systemic growth-regulation action. Synthetic auxin. | |
|
25059-80-7 | |
|
246-591-0 | |
|
136 | |
|
126801 | |
|
3034351 | |
|
271.72 | |
|
ethyl (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetate | |
|
ethyl 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetate | |
|
ethyl 4-chloro-2-oxo-3(2H)-benzothiazoleacetate | |
|
- | |
|
- | |
|
O | |
|
4 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
White crystalline solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as an aqueous suspension concentrate |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
47.0 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
229000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
603000 | L3 L = Pesticide manuals and hard copy reference books / other sources Dichloromethane3 = Unverified data of known source |
- | |||||||||
148000 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethyl acetate3 = Unverified data of known source |
- | |||||||||
28500 | L3 L = Pesticide manuals and hard copy reference books / other sources Toluene3 = Unverified data of known source |
- | |||||||||
|
79.2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
3.16 X 1002 | Calculated | - | |||||||
|
2.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
1.45 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.37 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
1.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
4.4 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- | |||||||
|
Oilseed rape straw, n=1 | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
Stable | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
Stable pH 4 to pH 7, DT₅₀: 7.6 days at pH 9, 25 °C | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slightly mobile | |||||||
|
1322 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.15 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
3.65 X 10-04 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Slightly mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
> 4000 | L3 L = Pesticide manuals and hard copy reference books / other sources Mouse3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 3000 | L3 L = Pesticide manuals and hard copy reference books / other sources Anas platyrhynchos3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 2.8 | L3 L = Pesticide manuals and hard copy reference books / other sources Lepomis macrochirus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
> 6.2 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
0.005 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
> 16.0 | L3 L = Pesticide manuals and hard copy reference books / other sources Pseudokirchneriella subcapitata3 = Unverified data of known source |
Low | ||||||||
|
> 1.0 | L3 L = Pesticide manuals and hard copy reference books / other sources Pseudokirchneriella subcapitata3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
> 1000 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 4000 | L3 L = Pesticide manuals and hard copy reference books / other sources Mouse3 = Unverified data of known source |
Low | ||||||||
|
2100 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
5.5 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.006 | L3 L = Pesticide manuals and hard copy reference books / other sources Dog3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H315, H319 Environment: H412 |
|||
|
N - Dangerous for the environment: R51, R53 | |||
|
S61 | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
benazolin ethyl | ||
|
benazoline-ethyl | ||
|
Benazolin-ethyl | ||
|
benazolin-ethyl | ||
|
benazolin-etile | ||
|
benazolin-etil | ||
|
benazolin-ethyl | ||
|
benazolina etylowa | ||
|
- | ||
|
- | ||
|
benazoline-ethyl |
Record last updated: | 31/12/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |