Sulprofos (Ref: NTN 9306) |
![]() Last updated: 02/07/2019 |
![]() |
(Also known as: mercaprofos; mercaprophos; sulprophos; BAY 123234) |
|
![]() |
|
An obsolete insecticide once used to control small plant-sucking pests | |
---|---|---|
|
Whiteflies; Aphids; Spider mites; Thrips | |
|
Cotton; Soybeans; Tobacco; Tomatoes; Vegetables; Maize; Peanuts; Lucerne | |
|
- | |
|
Obsolete | |
|
1978, first reported |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
A chiral molecule. | |
---|---|---|
|
C₁₂H₁₉O₂PS₃ | |
|
CCCSP(=S)(OCC)OC1=CC=C(C=C1)SC | |
|
No data | |
|
JXHJNEJVUNHLKO-UHFFFAOYSA-N | |
|
InChI=1S/C12H19O2PS3/c1-4-10-18-15(16,13-5-2)14-11-6-8-12(17-3)9-7-11/h6-9H,4-5,10H2,1-3H3 | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Organophosphate | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, non-systemic cholinesterase inhibitor | |
|
35400-43-2 | |
|
252-545-0 | |
|
8317 | |
|
111501 | |
|
37125 | |
|
322.45 | |
|
(E)-{O-ethyl O-[4-(methylsulfanyl)phenyl] S-propyl phosphorodithioate} | |
|
(RS)-[O-ethyl O-4-(methylthio)phenyl S-propyl phosphorodithioate] | |
|
O-ethyl O-(4-(methylthio)phenyl) S-propyl phosphorodithioate | |
|
Severe Marine Pollutant | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1B | |
|
Not applicable | |
|
Aphis gossypii, Bemisia tabaci, Heliothis virescens, Spodoptera littoralis | |
|
Colourless oil |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually formulated as an emulsifiable concentrate |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.31 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
-15 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
3.02 X 1005 | Calculated | - | |||||||
|
5.48 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.084 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Low volatility | ||||||||
|
8.70 X 10-02 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
143 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
0.8 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- | |||||||
|
Cotton leaves, n=1 | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | H3 H = The US ARS pesticide properties database (click here ) 3 = Unverified data of known source |
Non-mobile | |||||||
|
25900 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
-0.89 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
5.35 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW | ||||||||||||||||||||||||||||
|
High | Calculated | - | ||||||||||||||||||||||||||
|
Non-mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | - | - | |||||
|
Soil | - | - |
Other known metabolites |
|
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|---|
sulprofos oxon | - | Animal | - | - | |||||
sulprofos oxon sulfoxide | - | Animal | - | - | |||||
sulprofos oxon sulfone | - | Animal | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
9078 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
High potential | |||||||
|
Not available | - | |||||||||
|
176 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | L2 L = Pesticide manuals and hard copy reference books / other sources Rat 2 year2 = Unverified data of unknown source |
- | |||||||
|
6 | - | |||||||||
|
- | - | - | ||||||||
|
47 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 11 | L3 L = Pesticide manuals and hard copy reference books / other sources Lepomis macrochirus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
> 0.00083 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
91 | F2 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) Lemna minor 9 day2 = Unverified data of unknown source |
Low | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
64 | L3 L = Pesticide manuals and hard copy reference books / other sources Raphidocelis subcapitata3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
> 7.22 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
176 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
1064 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
4.1 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat 4 hr3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.003 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List I; List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302, H312 Environment: H411 |
|||
|
T - Toxic: R25 Xn - Harmful: R21 |
|||
|
- | |||
|
O (Obsolete substance) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
sulprofos | ||
|
sulprofos | ||
|
Sulprofos | ||
|
sulprofos | ||
|
sulprofos | ||
|
sulprofos | ||
|
- | ||
|
sulprofos | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 02/07/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |