Thiazafluron |
![]() Last updated: 04/01/2021 |
![]() |
(Not known by any other names) |
|
![]() |
|
An obsolete substituted urea herbicide to control annual and perennial broad-leaved weeds | |
---|---|---|
|
Total vegetation including difficult to control weeds such as nut-grass (Cyperus rotundas) | |
|
Non-crop areas such as roads, railways, industrial sites, rangeland | |
|
- | |
|
Obsolete | |
|
1973, first reported |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₆H₇F₃N₄OS | |
|
CNC(=O)N(C)C1=NN=C(S1)C(F)(F)F | |
|
No data | |
|
BBJPZPLAZVZTGR-UHFFFAOYSA-N | |
|
InChI=1S/C6H7F3N4OS/c1-10-4(14)13(2)5-12-11-3(15-5)6(7,8)9/h1-2H3,(H,10,14) | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Thiadiazolylurea | |
|
- | |
|
- | |
|
Synthetic | |
|
Non-selective, Photosynthetic electron transport inhibitor. | |
|
25366-23-8 | |
|
246-901-4 | |
|
8329 | |
|
- | |
|
32921 | |
|
240.21 | |
|
N,N'-dimethyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea | |
|
1,3-dimethyl-1-(5-trifluoromethyl-1,3,4-thiadiazol-2-yl)urea | |
|
N,N'-dimethyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea | |
|
- | |
|
- | |
|
C2 | |
|
5 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as a wettable powder or in a granular formulation |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
2100 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) at 25 °C3 = Unverified data of known source |
High | ||||||||
|
2100 | P3 P = Other governments and regulators Benzene3 = Unverified data of known source |
- | ||||||||
275000 | P3 P = Other governments and regulators Methanol3 = Unverified data of known source |
- | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
7.08 X 1001 | Calculated | - | |||||||
|
1.85 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
Low | ||||||||
|
1.51 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.488 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) at 25 °C3 = Unverified data of known source |
Low volatility | ||||||||
|
2.31 X 10-06 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) at 25 °C3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
125 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature states DT₅₀ 50-200 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Moderately mobile | |||||||
|
325 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.12 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
3.88 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Moderately mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6.2 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
Low potential | |||||||
|
Not available | - | |||||||||
|
278 | P3 P = Other governments and regulators Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 1000 | Q2 Q = Miscellaneous internet resources Unknown species2 = Unverified data of unknown source |
Low | ||||||||
|
- | - | - | ||||||||
|
> 970 | Q2 Q = Miscellaneous internet resources Unknown species2 = Unverified data of unknown source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
228 | Q1 Q = Miscellaneous internet resources Estimated1 = Estimated data with little or no verification |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
278 | P3 P = Other governments and regulators Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2150 | P3 P = Other governments and regulators Rat3 = Unverified data of known source |
- | ||||||||
|
> 0.35 | P3 P = Other governments and regulators Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302 Environment: H400, H410 |
|||
|
Xn - Harmful: R22 N - Dangerous for the environment: R50, R53 |
|||
|
S2, S60, S61 | |||
|
O (Obsolete substance) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
thiazafluron | ||
|
thiazafluron | ||
|
Thiazafluron | ||
|
thiazafluron | ||
|
tiazafluron | ||
|
tiazafluron | ||
|
- | ||
|
tiazafluron | ||
|
- | ||
|
- | ||
|
thiazfluron |
Record last updated: | 04/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |