Tridemorph (Ref: BAS 2205-F) |
![]() Last updated: 27/11/2019 |
![]() |
(Also known as: morpholine; calixin) |
|
![]() |
|
A fungicide used to control the fungus Erysiphe graminis in cereals and a range of other diseases | |
---|---|---|
|
Powdery mildew; Rust; Leaf blotch; Eyespot | |
|
Cereals; Bananas; Tea; Vegetables; Ornamentals | |
|
- | |
|
Current | |
|
1969, Germany |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Australia |
---|
Chemical structure |
|
A molecule with two chiral centres | |
---|---|---|
|
C₁₉H₃₉NO | |
|
CCCCCCCCCCCCCN1CC(OC(C1)C)C | |
|
No data | |
|
YTOPFCCWCSOHFV-UHFFFAOYSA-N | |
|
InChI=1S/C19H39NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-20-16-18(2)21-19(3)17-20/h18-19H,4-17H2,1-3H3 | |
|
Yes |
General status |
|
Fungicide | |
---|---|---|
|
Morpholine | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic with eradicant action, absorbed by leaves and shoots, some protectant properties. Disrupts membrane function. | |
|
81412-43-3 | |
|
24602-86-6 | |
|
246-347-3 | |
|
324 | |
|
121401 | |
|
32518 | |
|
297.52 | |
|
for major component is (2?,6?)-2,6-dimethyl-4-tridecylmorpholine | |
|
reaction mixture of 4-alkyl-2,6-dimethylmorpholines, where “alkyl” is mixture of C11–C14 homologues of which 60–70% is tridecyl | |
|
tridemorph | |
|
OSPAR soc; Chemical subject to PIC regulations | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
5 | |
|
- | |
|
Yellow oily liquid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as an emulsifiable concentrate |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
1.1 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Ethanol3 = Unverified data of known source |
- | ||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Ethyl acetate3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Benzene3 = Unverified data of known source |
- | |||||||||
|
Not applicable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.58 X 1004 | Calculated | - | |||||||
|
4.2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
0.86 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
6.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
Weak acid | |||||||||||
|
12 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile | ||||||||
|
3.20 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
24 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
35 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent | ||||||||
|
24 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Lab studies DT₅₀ range 20-50 days, field studies DT₅₀range 14-34 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
0.7 | K3 K = Research datasets, e.g. Pandora, Demetra 3 = Unverified data of known source |
Fast | |||||||
|
- | ||||||||||
|
|
32 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderately persistent | |||||||
|
- | ||||||||||
|
60 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Moderately fast | ||||||||
|
26 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slow |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-mobile | |||||||
|
6250 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.28 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
7.39 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Non-mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
741 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
Threshold for concern | |||||||
|
Not available | - | |||||||||
|
500 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) Rat5 = Verified data used for regulatory purposes |
Moderate | ||||||||
|
|
5 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) Rat5 = Verified data used for regulatory purposes |
High | |||||||
|
50 | - | |||||||||
|
- | - | - | ||||||||
|
> 1388 | L3 L = Pesticide manuals and hard copy reference books / other sources Phasianidae3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 3.4 | L3 L = Pesticide manuals and hard copy reference books / other sources Salmonidae3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
> 1.3 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
0.28 | L2 L = Pesticide manuals and hard copy reference books / other sources Unknown species2 = Unverified data of unknown source |
Moderate | ||||||||
|
0.015 | Q2 Q = Miscellaneous internet resources Unknown species2 = Unverified data of unknown source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
200 | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Low | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
880 | L3 L = Pesticide manuals and hard copy reference books / other sources Eisenia foetida3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
Harmless | [Dose: 300 g ha⁻¹] AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Typhlodromus pyri3 = Unverified data of known source |
- | |||
|
|
- | - | - |
|
Harmless | [Dose: 300 g ha⁻¹] AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Cheiracanthium mildei3 = Unverified data of known source |
- | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
500 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) Rat5 = Verified data used for regulatory purposes |
Moderate | ||||||||
|
4000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
4.5 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat 4 hr3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.016 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Moderately toxic May cause dermatitis or conjunctivitis |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302, H315, H332, H360D Environment: H400, H410 |
|||
|
Reproduction risk category 2: R61 Xn - Harmful: R20/22 Xi - Irritant: R38 N - Dangerous for the environment: R50, R53 |
|||
|
S45, S53, S60, S61 | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
tridemorph | ||
|
tridemorphe | ||
|
Tridemorph | ||
|
tridemorph | ||
|
tridemorf | ||
|
tridemorf | ||
|
- | ||
|
tridemorf | ||
|
- | ||
|
tridemorf | ||
|
tridemorf |
Record last updated: | 27/11/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |