Bensultap (Ref: OMS 3011) |
![]() Last updated: 18/12/2020 |
![]() |
(Also known as: TI 78; TI 1671) |
SUMMARY |
Bensultapis an insecticide that is not approved for use in the EU. It has a low aqueous solubility, is quite volatile and not expected to leach to groundwater. It is not persistent in soil systems but may be persistent in water under some environmental conditions. Bensultap is moderately toxic to mammals and most species of fauna and flora. |
|
![]() |
|
A nereistoxin analogue insecticide used to control major crop pests including Coleoptera and Lepidoptera | |
---|---|---|
|
Colorado beetle; Corn weevil; Diamond back moth; Rice stem borers; Grape berry moth; Tortoise beetles | |
|
Apples; Rice; Tea; Cotton; Grapes; Potatoes | |
|
- | |
|
Unknown | |
|
1983, first marketed |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₇H₂₁NO₄S₄ | |
|
CN(C)C(CSS(=O)(=O)C1=CC=CC=C1)CSS(=O)(=O)C2=CC=CC=C2 | |
|
No data | |
|
YFXPPSKYMBTNAV-UHFFFAOYSA-N | |
|
InChI=1S/C17H21NO4S4/c1-18(2)15(13-23-25(19,20)16-9-5-3-6-10-16)14-24-26(21,22)17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3 | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Nereistoxin analogue | |
|
- | |
|
- | |
|
Synthetic | |
|
Contact and stomach action affecting the pest central nervous system. | |
|
17606-31-4 | |
|
- | |
|
464 | |
|
- | |
|
87176 | |
|
431.6 | |
|
S,S'-[2-(dimethylamino)propane-1,3-diyl] dibenzenesulfonothioate | |
|
S,S'-2-dimethylaminotrimethylene di(benzenethiosulfonate) | |
|
S,S'-(2-(dimethylamino)-1,3-propanediyl) di(benzenesulfonothioate) | |
|
Chemical subject to PIC regulations | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
4C | |
|
Not applicable | |
|
None identified | |
|
Pale yellow crystalline powder |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Available as dusts, granules and wettable powders |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.75 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
319 | L3 L = Pesticide manuals and hard copy reference books / other sources Hexane3 = Unverified data of known source |
- | ||||||||
83300 | L3 L = Pesticide manuals and hard copy reference books / other sources Toluene3 = Unverified data of known source |
- | |||||||||
10480 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | |||||||||
149000 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethyl acetate3 = Unverified data of known source |
- | |||||||||
|
82.2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Decomposes before boiling | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
Not expected to self ignite; Not highly flammable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
2.29 X 1003 | Calculated | - | |||||||
|
3.36 | T4 T = UN EPFA database 4 = Verified data |
High | ||||||||
|
- | - | - | ||||||||
|
Not applicable | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
No dissociation | |||||||||||
|
0.21 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
4.46 X 10-09 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
7 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Non-persistent | |||||||
|
7 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Stable | |||||||
|
- | ||||||||||
|
|
0.004 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Non-persistent | |||||||
|
Rapidly hydrolysed at pH 5-9 | ||||||||||
|
2 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Fast | ||||||||
|
2 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderately fast |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | W3 W = French database provided by ARVALIS-Institut du Végétal 3 = Unverified data of known source |
Slightly mobile | |||||||
|
1118 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.80 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
7.65 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Slightly mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
100 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
Threshold for concern | |||||||
|
Not available | - | |||||||||
|
1105 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | |||||||
|
250 | - | |||||||||
|
- | - | - | ||||||||
|
311 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.76 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
20 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
1 | K3 K = Research datasets, e.g. Pandora, Demetra Unknown species3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
25.9 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
30 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
1105 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rabbit3 = Unverified data of known source |
- | ||||||||
|
0.47 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302 Environment: H400, H410 |
|||
|
Xn - Harmful: R22 N - Dangerous for the environment: R50, R53 |
|||
|
S2, S61, S60 | |||
|
II (Moderately hazardous) | |||
|
2902 | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
bensultap | ||
|
bensultap | ||
|
Bensultap | ||
|
bensultap | ||
|
bensultap | ||
|
bensultap | ||
|
bensultap | ||
|
bensultap | ||
|
- | ||
|
bensultap | ||
|
bensultap |
Record last updated: | 18/12/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |