Thiocyclam hydrogen oxalate (Ref: SAN 1551) |
![]() Last updated: 29/06/2019 |
![]() |
(Also known as: thiocyclam (ethanedioate 1:1)) |
|
![]() |
|
A broad spectrum insecticide used to control sucking and chewing pests on a variety of crops | |
---|---|---|
|
Spidermites; caterpillars; Thrips; Plant hoppers; Whiteflies; Wooly aphids | |
|
Oilseed rape; Ornamentals including roses; Onions; Apples and pears | |
|
- | |
|
Unknown | |
|
circa 1975 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₇H₁₃NO₄S₃ | |
|
CN(C)C1CSSSC1.C(=O)(C(=O)O)O | |
|
No data | |
|
ICTQUFQQEYSGGJ-UHFFFAOYSA-N | |
|
InChI=1S/C5H11NS3.C2H2O4/c1-6(2)5-3-7-9-8-4-5;3-1(4)2(5)6/h5H,3-4H2,1-2H3;(H,3,4)(H,5,6) | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Unclassified | |
|
- | |
|
- | |
|
Synthetic | |
|
A nereistoxin analogue insecticide. Selective, stomach acting with some contact action. Nicotinic acetylcholine receptor agonist/anatagonist. | |
|
31895-22-4 | |
|
250-859-2 | |
|
- | |
|
128868 | |
|
35969 | |
|
271.37 | |
|
- | |
|
N,N-dimethyltrithian-5-amine;oxalic acid | |
|
N,N-dimethyl-1,2,3-trithian-5-amine hydrogen oxalate | |
|
Chemical subject to PIC regulations | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
14 | |
|
Not applicable | |
|
- | |
|
White solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as a soluble powder or as granules |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
16300 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
17000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | ||||||||
1900 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethanol3 = Unverified data of known source |
- | |||||||||
500 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
10 | L3 L = Pesticide manuals and hard copy reference books / other sources Hexane3 = Unverified data of known source |
- | |||||||||
|
126 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
8.51 X 10-01 | Calculated | - | |||||||
|
-0.07 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
0.6 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
3.95 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
pKa(2) 7.0 | |||||||||||
|
0.545 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
1.8 X 10-06 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
6 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
1 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature DT₅₀ range 0.5-3.8 days (R3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately fast | |||||||
|
- | ||||||||||
|
|
6 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
pH sensitive: 0.5 years at pH 5, 5 - 7 days at pH 7-9 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Mobile | |||||||
|
20 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.00 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
1.11 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
399 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
3.45 | L3 L = Pesticide manuals and hard copy reference books / other sources Coturnix japonica3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.04 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
2.01 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
3.3 | L3 L = Pesticide manuals and hard copy reference books / other sources Scenedemus subspicatus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
11.9 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
399 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Harmful if swallowed |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG Transport group 6.1 | |||
|
Health: H302, H312 | |||
|
Xn - Harmful: R22, R43 Xi - Irritant: R36, R38 |
|||
|
S2, S13, S20, S21, S46, S36/37 | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
Packaging Group III (minor danger) |
|
![]() |
|
|
||
---|---|---|---|
|
thiocyclam hydrogen oxalate | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 29/06/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |