| Propylene glycol |  Last updated: 15/09/2025 |  | (Also known as: methylethyl glycol; E1520) | 
| 
 |   | 
| 
 | A synthetic food and feed additive | |
|---|---|---|
| 
 | Used for the treatment of acetonaemia and ketosis, to aid the delivery of skin healing medication as well as a general purpose feed additive | |
| 
 | Dogs; Cattle; Sheep; Horses | 
| Approval status | 
| 
 | Approved - authorisation legal class is variable and depends on product and application | |
|---|---|---|
| 
 | Approved | 
| Chemical structure | 
| 
 | None | |
|---|---|---|
| 
 | C₃H₈O₂ | |
| 
 | CC(CO)O | |
| 
 | No data | |
| 
 | DNIAPMSPPWPWGF-UHFFFAOYSA-N | |
| 
 | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 | |
| 
 | Yes | 
| General status | 
| 
 | Feed additive | ||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | Solvent; Humectant; Carrier | ||||||||||||||
| 
 | Unclassified substance | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | Synthetic | ||||||||||||||
| 
 | Inert | ||||||||||||||
| 
 | [No molecular target - physical mode of action] | ||||||||||||||
| 
 | 57-55-6 | ||||||||||||||
| 
 | 200-338-0 | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | 068603 | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | Alimentary tract & metabolism: Other alimentary tract & metabolism products | ||||||||||||||
| 
 | QA16QA01 | ||||||||||||||
| 
 | No | ||||||||||||||
| 
 | Allowed substance (Table 1: All food producing species) | ||||||||||||||
| 
 | 76.09 | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | propane-1,2-diol | ||||||||||||||
| 
 | 1,2-propanediol | ||||||||||||||
| 
 | 
 | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | Colourless viscous liquid | ||||||||||||||
| Commercial | 
| 
 | 
 | |||
|---|---|---|---|---|
| 
 | Current | |||
| 
 | 1942, GRAS status USA | |||
| 
 | 
 | |||
| 
 | 
 | |||
| 
 | Available in a variety of formulations including creams and ointments, oral drenches and oral solutions | |||
| 
 | The production of propylene glycol primarily involves the hydration of propylene oxide, a compound derived from petroleum or natural gas. In this process, propylene oxide reacts with water, either under high temperature and pressure or in the presence of a catalyst, to yield a mixture of mono- and di-propylene glycol, with propylene glycol being the major product. Alternative methods include the chlorohydrin process and biobased synthesis from glycerol or lactic acid, offering more sustainable routes. | |||
| 
 | The production of propylene glycol emits approximately 4.17 kilograms of CO₂e per kilogram of product. This figure reflects the climate footprint based on a benchmark industrial process and includes emissions from raw material sourcing, chemical processing, and energy use. The majority of the emissions stem from fossil resource inputs, about 77%, while the remaining 23% comes from processing energy. | 
| 
 |   | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 1000000 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )at  25 °C 3 = Unverified data of known source | High | ||||||||
| 
 | Miscible | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )Ethanol 3 = Unverified data of known source | - | ||||||||
| Miscible | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )Acetone 3 = Unverified data of known source | - | |||||||||
| Miscible | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )Chloroform 3 = Unverified data of known source | - | |||||||||
| Miscible | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )Ether 3 = Unverified data of known source | - | |||||||||
| 
 | -59 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | 1.20 X 10-01 | Calculated | - | |||||||
| 
 | -0.92 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source | Low | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | 1.036 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | - | ||||||||
| 
 | 14.9 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source | - | ||||||||
| Very weak acid | |||||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | ||||||||||
| Degradation | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | ||||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. | ||||||||||
| 
 | - | ||||||||||
| Soil adsorption and mobility | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | - | ||||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | - | ||||||||||
| 
 | - | ||||||||||
| 
 | - | ||||||||||
| Fate indices | 
| 
 | 
 | 
 | 
 | ||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | - | - | - | ||||||||||||||||||||||||||
| 
 | 
 | - | - | - | |||||||||||||||||||||||||
| 
 | - | - | |||||||||||||||||||||||||||
| Known metabolites | 
None
| 
 |   | 
| Terrestrial ecotoxicology | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | > 20000 | Q3 Q = Miscellaneous data from online sourcesRat 3 = Unverified data of known source | Low | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | |||||||||
| 
 | - | - | - | ||||||||
| 
 | 2080 | Q3 Q = Miscellaneous data from online sourcesColinus virginianus 3 = Unverified data of known source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | ||||||||||
| 
 | 
 | - | - | - | |||||||
| - | |||||||||||
| 
 | - | - | - | ||||||||
| - | |||||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| Aquatic ecotoxicology | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 710 | Q2 Q = Miscellaneous data from online sourcesPimephales promelas 2 = Unverified data of unknown source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 10000 | Q3 Q = Miscellaneous data from online sourcesDaphnia magna 3 = Unverified data of known source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | 
 | - | - | - | |||
| 
 | - | - | - | ||||||||
| 
 |   | 
| General | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | Low (class I) | - | - | ||||||||
| 
 | > 20000 | Q3 Q = Miscellaneous data from online sourcesRat 3 = Unverified data of known source | Low | ||||||||
| 
 | > 20800 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )Rat 3 = Unverified data of known source | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | |||||||||
| 
 | - | ||||||||||
| 
 | Mainly eliminated unchanged in the urine | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | - | ||||||||
| Health issues | 
| 
 | 
 | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | Possible liver and kidney toxicant May cause seizures, coma, arrhythmias & cardiorespiratory arrest | ||||||||||||||||||||||||||||
| Handling issues | 
| 
 | 
 | |||
|---|---|---|---|---|
| 
 | Flammable | |||
| 
 | - | |||
| 
 | Not listed (Not listed) | |||
| 
 | - | |||
| 
 | - | |||
| 
 | - | 
| 
 |   | 
| 
 | 
 | ||
|---|---|---|---|
| 
 | propylene glycol | ||
| 
 | - | ||
| 
 | 1,2-Propylenglykol | ||
| 
 | - | ||
| 
 | - | ||
| 
 | - | ||
| 
 | - | ||
| 
 | propylenowo-glikolowy | ||
| 
 | - | ||
| 
 | - | ||
| 
 | - | ||
| 
 | - | 
| Record last updated: | 15/09/2025 | 
| Contact: | aeru@herts.ac.uk | 
| Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 | 


