| Kaolin |  Last updated: 25/10/2025 |  | (Also known as: argilla; bentone; china clay; porcelain clay; neokaolin ; aluminium silicate hydrate; hydrated aluminium silicate) | 
| 
 |   | 
| 
 | Aluminum silicate administered as animal feed supplement | |
|---|---|---|
| 
 | Mainly used as a treatment for diarrhoea by adsorbing water, toxins and bacteria, contributing to firmer stools and so reducing fluid loss | |
| 
 | Pigs; Dogs; Cats; Poultry | 
| Approval status | 
| 
 | Approved - usually authorised as a veterinary medicine for general sale (AVM-GSL) | |
|---|---|---|
| 
 | Approved | 
| Chemical structure | 
| 
 | None | |
|---|---|---|
| 
 | H₄Al₂O₉Si₂ | |
| 
 | O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O | |
| 
 | - | |
| 
 | NLYAJNPCOHFWQQ-UHFFFAOYSA-N | |
| 
 | InChI=1S/2Al.O5Si2.2H2O.2O/c;;1-6(2)5-7(3)4;;;;/h;;;2*1H2;;/q2*+1;-2;;;; | |
| 
 | Yes | 
| General status | 
| 
 | Feed additive | ||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | Coating agent | ||||||||||||||
| 
 | Inorganic compound | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | Natural | ||||||||||||||
| 
 | For crop protection it mainly has a non-toxic mode of action, acting via its physical properties. It may also interfere with feeding behaviour and egg-laying. For animal health it can bind toxins, bacteria, and excess water in the gut. It adheres to the gastrointestinal mucosa, forming a protective coating that helps prevent the absorption of harmful substances. | ||||||||||||||
| 
 | [No specific molecular target] | ||||||||||||||
| 
 | 1332-58-7 | ||||||||||||||
| 
 | 310-194-1 | ||||||||||||||
| 
 | None allocated | ||||||||||||||
| 
 | 100104 | ||||||||||||||
| 
 | 56841936 | ||||||||||||||
| 
 | No data found | ||||||||||||||
| 
 | Alimentary tract & metabolism: Intestinal antiinfectives | ||||||||||||||
| 
 | QA07AA51 | ||||||||||||||
| 
 | No | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | 258.16 | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate | ||||||||||||||
| 
 | aluminium silicate hydrate | ||||||||||||||
| 
 | 
 | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | - | ||||||||||||||
| 
 | Off-white coloured powder | ||||||||||||||
| Commercial | 
| 
 | 
 | |||
|---|---|---|---|---|
| 
 | Current | |||
| 
 | 1997, first registered as pesticide USA | |||
| 
 | 
 | |||
| 
 | 
 | |||
| 
 | Usually formulated as a powder, granules, oral suspensions and poultices | |||
| 
 | Kaolin is produced commercially through several key steps. Firstly, kaolin mineral deposits are typically extracted from open-pit mines. The extracted kaolin is mixed with water to create a slurry. This process, known as blunging, helps to break down the clay and remove impurities. The slurry is then screened to remove coarse particles and centrifuged to separate the kaolin from sand and other impurities. Further refinement involves de-gritting, where finer particles are separated from the kaolin slurry. The refined kaolin slurry is filtered to remove excess water and then dried. This can be done using rotary dryers, spray dryers, or filter presses. For certain applications, kaolin may be calcined (heated to high temperatures) to enhance its properties, such as brightness and hardness. The dried kaolin is milled to achieve the desired particle size and consistency. | |||
| 
 | According to emissions modeling based on the ecoinvent database wet-process kaolin production emits approximately 0.13–0.25 kg CO₂e per kg of kaolin produced. | 
| 
 |   | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 5.0 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 1760 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | Not applicable | - | - | |||||||
| 
 | Not applicable | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | Not applicable | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | 2.6 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | - | ||||||||
| 
 | - | - | - | ||||||||
| - | |||||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 1.620 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | - | ||||||||
| 
 | - | ||||||||||
| Degradation | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
 | 1000 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | Very persistent | |||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | Kaolin is a non-degradable natural component of the environment | ||||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. | ||||||||||
| 
 | - | ||||||||||
| Soil adsorption and mobility | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | Kaolin is a natural component of the environment | ||||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | - | ||||||||||
| 
 | - | ||||||||||
| 
 | - | ||||||||||
| Fate indices | 
| 
 | 
 | 
 | 
 | ||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | - | - | - | ||||||||||||||||||||||||||
| 
 | 
 | 20 | Q3 Q = Miscellaneous data from online sourcesLow risk 3 = Unverified data of known source | Low potential | |||||||||||||||||||||||||
| 
 | - | - | |||||||||||||||||||||||||||
| Known metabolites | 
None
| 
 |   | 
| Terrestrial ecotoxicology | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | > 5000 | R4 R = Peer reviewed scientific publicationsRat 4 = Verified data | Low | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | |||||||||
| 
 | - | - | - | ||||||||
| 
 | > 5000 | R3 R = Peer reviewed scientific publicationsUnknown species 3 = Unverified data of known source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | > 2000 | R3 R = Peer reviewed scientific publicationsEisenia foetida 3 = Unverified data of known source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | > 100 | R4 R = Peer reviewed scientific publicationsApis mellifera 4 = Verified data | Low | |||||||
| 
 | > 100 | R4 R = Peer reviewed scientific publicationsApis mellifera 4 = Verified data | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | ||||||||||
| 
 | 
 | - | - | - | |||||||
| - | |||||||||||
| 
 | - | - | - | ||||||||
| - | |||||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | 
 | - | - | - | |||||||
| 
 | - | ||||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| Aquatic ecotoxicology | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | > 2500 | R3 R = Peer reviewed scientific publicationsUnknown species 3 = Unverified data of known source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | > 2500 | R3 R = Peer reviewed scientific publicationsUnknown species 3 = Unverified data of known source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | > 2500 | A3 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications )Unknown species 3 = Unverified data of known source | Low | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | - | - | 
 | - | - | - | |||
| 
 | - | - | - | ||||||||
| 
 |   | 
| General | 
| 
 | 
 | 
 | 
 | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | High (class III) | - | - | ||||||||
| 
 | > 5000 | R4 R = Peer reviewed scientific publicationsRat 4 = Verified data | Low | ||||||||
| 
 | > 5000 | R4 R = Peer reviewed scientific publicationsRat 4 = Verified data | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | None allocated | A5 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications ) 5 = Verified data used for regulatory purposes | - | ||||||||
| 
 | None allocated | A5 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications ) 5 = Verified data used for regulatory purposes | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | None allocated | A5 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications ) 5 = Verified data used for regulatory purposes | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | - | - | - | ||||||||
| 
 | 
 | - | |||||||||
| 
 | - | ||||||||||
| 
 | Poorly absorbed from the gastrointestinal tract, has a short half-life and is nearly all excreted unchanged | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source | - | ||||||||
| Health issues | 
| 
 | 
 | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | Inhalation may cause pneumoconiosis (Kaolinosis) May produce gastrointestinal disturbances as high doses Possible respiratory sensitiser May cause toxic responses via inhalation CLP data - known human carcinogen | ||||||||||||||||||||||||||||
| Handling issues | 
| 
 | 
 | |||
|---|---|---|---|---|
| 
 | No information available | |||
| 
 | Health: H315, H319, H334, H335, H350, H370, H372, H373 | |||
| 
 | Not listed (Not listed) | |||
| 
 | - | |||
| 
 | - | |||
| 
 | - | 
| 
 |   | 
| 
 | 
 | ||
|---|---|---|---|
| 
 | kaolin | ||
| 
 | kaolin | ||
| 
 | Porzellanerde | ||
| 
 | kaolin | ||
| 
 | caolino | ||
| 
 | caolin | ||
| 
 | kaoline | ||
| 
 | - | ||
| 
 | kaolin | ||
| 
 | porcelanfold | ||
| 
 | kaolien | ||
| 
 | - | 
| Record last updated: | 25/10/2025 | 
| Contact: | aeru@herts.ac.uk | 
| Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 | 


