| Geraniol (Ref: Mevalone 3AEY) |

Last updated: 13/03/2026
|
 |
(Also known as: (E)-geraniol; (E)-nerol; AI3-00206; Lemonol) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A plant derived alcohol that has fungicidal, insecticidal and microbial activity. Recent research suggest it may have value as a repellent for ticks on cattle. |
|
|
Botrytis; Mosquitoes; Flies; Fleas; Ticks |
|
|
Grapes |
|
|
- |
|
|
- |
|
|
- |
|
|
Approved |
|
|
30/11/2031 |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Spain/Greece |
|
|
30/04/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
✓ |
✓ |
✓ |
  |
  |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
  |
✓ |
  |
  |
  |
✓ |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Geraniol exhibits isomerism primarily through its geometrical and structural forms. It exists as a trans-isomer, while its cis-isomer counterpart is nerol. Geraniol also has structural isomers like linalool and citronellal, which differ in atom connectivity or functional groups, leading to distinct aromas and applications. Although geraniol itself is not optically active, some of its isomers are. |
|
|
C₁₀H₁₈O |
|
|
CC(=CCCC(=CCO)C)C |
|
|
CC(=CCC/C(=C/CO)/C)C |
|
|
GLZPCOQZEFWAFX-JXMROGBWSA-N |
|
|
InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
|
|
Yes |
|
|
Fungicide; Insecticide; Microbiocide; Veterinary substance |
|
|
Plant-derived substance |
|
|
980 g/Kg |
|
|
EU dossier - none declared |
|
|
Natural |
|
|
Though to distrupt the cell walls, membranes and organelles of micro-organisms. Geraniol interacts with voltage-gated sodium channels and detoxifying enzymes like glutathione-S-transferase, disrupting normal function. |
|
|
- |
|
|
A primary consitutent of rose, palmarosa and citronella oil |
|
|
Viticulture; Insect repellent; Animal welfare |
|
|
- |
|
|
106-24-1 |
|
|
203-377-1 |
|
|
- |
|
|
597501 |
|
|
- |
|
|
154.25 |
|
|
- |
|
|
(E) 3,7-dimethyl-2,6-octadien-1-ol |
|
|
(E) 3,7-dimethyl-2,6-octadien-1-ol |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FEMA=2507; FLAVIS=02.012; USEPA minimum risk pesticide |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale yellow, clear viscous liquid with a floral odor |
|
|
|
|
|
|
|
|
Current |
|
|
Early 20th century, first natural isolation; Mid 20th century first commercial use; 2013, not approved UK |
|
|
- Eden Research plc
- Bugband USA
|
|
|
- Trisoprene
- EDEM
- Bugband Insect Repellent
|
|
|
Usually supplied as a capsule suspension for aqueous dilution and application via hydraulic or knapsack sprayers |
|
|
The commercial production of geraniol, typically involves two main approaches: natural extraction and biotechnological synthesis. Traditionally, geraniol is obtained through steam distillation of plant materials, which separates the volatile oil from the biomass. Microbial fermentation uses genetically engineered strains of Escherichia coli or Saccharomyces cerevisiae that express terpene biosynthetic pathways. These microbes are cultivated in bioreactors under controlled conditions, and geraniol is either secreted or retained intracellularly, requiring downstream purification. To overcome toxicity issues and improve yield, some systems employ in vivo esterification, converting geraniol into geranyl acetate, which is easier to extract and more stable. |
|
|
Data for specific plant extracts is scarce. However, from publicly available data the carbon footprint of plant extracts has been estimated at between 1.0 and 4.0 kg CO₂e per kg of product. This depends on the plant composition, agricultural practices and processing methods used. |
|
|
|
|
|
|
|
|
|
|
572 |
|
Moderate |
|
|
250000 |
n-Heptane |
- |
| 250000 |
Methanol |
- |
| 250000 |
Ethyl acetate |
- |
| 250000 |
Acetone |
- |
|
|
50 |
|
- |
|
|
230 |
|
- |
|
|
- |
- |
- |
|
|
96.5 |
|
- |
|
|
|
6.46 X 1003 |
Calculated |
- |
|
|
3.81 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.889 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
4600 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
1.22 |
|
Moderately volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
No absorption >290nm |
|
- |
|
|
40.7 |
|
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Mobile |
|
|
71 |
|
|
Data caluated using predictive software |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 4000 |
Rat |
Low |
|
|
558 |
Rat 13-wk |
Low |
|
|
558 |
Rat |
Low |
|
|
> 10000 |
Colinus virginianus as product |
Low |
|
|
> 5866 |
Colinus virginianus as product |
- |
|
|
- |
- |
- |
|
|
> 500 |
Eisenia foetida as product corr |
Moderate |
|
|
- |
- |
- |
|
|
Nitrogen mineralisation: No significant adverse effect Carbon mineralisation: No significant adverse effect |
Dose 54.5 mg product/kg soil |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 200 |
as formulation |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
11.6 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
16.1 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
48.0 |
Raphidocelis subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
111.6 |
Worst case of acute and chronic mammals |
|
|
1000 |
Worst case of acute and chronic birds |
|
|
50 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
4 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.116 |
Worst case of temperate acute and chronic fish |
|
|
0.161 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
4.8 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 4000 |
Rat |
Low |
|
|
558 |
Rat 13-wk |
Low |
|
|
558 |
Rat |
Low |
|
|
> 2000 |
Rat |
- |
|
|
- |
- |
- |
|
|
Subcutaneous LD₅₀ = 1090 mg kg⁻¹ |
Mouse |
- |
| Intravenous LD₅₀ = 50 mg kg⁻¹ |
Mouse |
- |
|
|
0.5 |
Rat SF=100 |
- |
|
|
None allocated |
|
- |
|
|
Not applicable |
|
- |
|
|
0.5 |
Rat SF =100 |
- |
|
|
100 |
Default |
- |
|
|
- |
- |
- |
|
|
|
Acceptable for proposed uses |
|
|
Acceptable for proposed uses |
|
|
Extensively and rapidly absorbed, excreted via urine (>50% in 24hr) |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A2 A = Chromosome aberration (EFSA database) 2 = Mixed/ambiguous results ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
May case gastric irritation Possible liver, heart and kidney toxicant |
|
|
|
|
|
Not explosive or oxidising |
|
|
Health: H319, H315, H317 |
|
|
Not listed |
|
|
Not regulated |
|
|
- |
|
|
- |
|
|
|
|
|
geraniol |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
13/03/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.