| Pyrethrins (cinerin I) |

Last updated: 22/10/2025
|
 |
(Also known as: pyrethum; cinerin) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
A non-persistent insecticide extracted from Pyrethrum used to control a variety of pests on crops, in domestic and public health situations |
|
|
A wide range of insects and mites |
|
|
Vegetables; Fruit; Protected crops; Ornamentals; Public areas |
|
|
- |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Italy/Germany |
|
|
15/06/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
  |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
USA, East Africa, Australia |
|
|
Cinerin I exhibits stereoisomerism due to its complex molecular structure. It contains three chiral centres, which means the molecule can exist in multiple stereoisomeric forms depending on the spatial arrangement of its atoms around these centres. Additionally, cinerin I includes a cyclopropane ring and a conjugated diene system, contributing to geometric (cis/trans or E/Z) isomerism. The biologically active form of cinerin I is a specific stereoisomer, with defined configurations at each chiral centre and double bond, which is crucial for its insecticidal activity. |
|
|
C₂₀H₂₈O₃ |
|
|
CC=CCC1=C(C(CC1=O)OC(=O)C2C(C2(C)C)C=C(C)C)C |
|
|
C/C=C\CC1=C([C@@H](CC1=O)OC(=O)[C@@H]2[C@H](C2(C)C)C=C(C)C)C |
|
|
FMTFEIJHMMQUJI-RWRPJIPASA-N |
|
|
InChI=1S/C20H28O3/c1-7-8-9-14-13(4)17(11-16(14)21)23-19(22)18-15(10-12(2)3)20(18,5)6/h7-8,10,15,17-18H,9,11H2,1-6H3/b8-7-/t15-,17-,18+/m1/s1 |
|
|
Yes |
|
|
Insecticide; Acaricide; Veterinary substance |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Contact acting neurotoxins with repellent properties. Sodium channel modulator. |
|
|
Originally isolated from the dried powdered flowers of the plant genus Chrysanthemum |
|
|
Crop protection; Public health |
|
|
A wide range of insects and mites |
|
|
Vegetables; Fruit; Protected crops; Ornamentals; Public areas |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
25402-06-6 |
|
|
8003-34-7 |
|
|
246-948-0 |
|
|
32 |
|
|
- |
|
|
- |
|
|
316.4 |
|
|
- |
|
|
(Z)-(S)-3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl(1R)-trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
|
|
(1R-(1α(S(Z),3β))-3-(2-butenyl)-2-methyl-4-oxo-2-cyclopenten-1-yl 2,2-dimethyl-3-(2-methyl-1-propenyl) cyclopropanecarboxylate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R09 Rule 9: Pesticide active ingredients that have demonstrated a high aquatic toxicity (where acute ecotoxicity for fish, invertebrates or algae =< 0.1 mg l⁻¹) ; R10 Rule 10: Pesticide active ingredients that have demonstrated a high toxicity to bees (where contact or oral bee toxicity =< 2 μg bee⁻¹) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
3A |
|
|
Not applicable |
|
|
Blattella germanica, Boophilus decoloratus, Myzus persicae, Plodia interpunctella, Spodoptera litura, many others |
|
|
Viscous amber coloured liquid |
|
|
|
|
|
|
|
|
Current |
|
|
Circa 1930, introduced |
|
|
- MGK
- Diatect International
- Agropharm Ltd
|
|
|
- Evergreen Crop Protection 60-6
- Diatect II
- Pyrethrum 5EC concentrate
|
|
|
Available in a variety of formulations including ultra low-volume liquids and ready-to-use sprays for crop and public health applications and as powders, shampoos and impregnated collars for animals. |
|
|
Chrysanthemum cinerariifolium plants are cultivated and once blooming the flowers are harvested and dried. The dried flower heads are processed to extract the pyrethrins. This is typically done using a proprietary extraction method that maintains the natural composition of the pyrethrins. The crude extract contains a mixture of pyrethrins, including pyrethrin I, pyrethrin II, cinerins, and jasmolins. Cinerin I is isolated using chromatography and fraction collection. The collected fraction is then purified. |
|
|
There are no precise, published data on the GHG emissions associated with the production of pyrethrins. However, based on similar plant-derived biopesticides, the estimated emissions would be expected to be around 3.0–6.5 kg CO₂e per kg of pyrethrins. |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
250000 |
n-Heptane |
- |
| 250000 |
p-Xylene |
- |
| 250000 |
Methane |
- |
| 250000 |
Acetone |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
190 |
|
- |
|
|
- |
- |
- |
|
|
|
3.47 X 1005 |
Calculated |
- |
|
|
5.54 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.85 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Not applicable |
|
- |
| No dissociation |
|
|
6.93 X 10-02 |
|
Low volatility |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
52.8 |
as pyrethrins |
- |
|
|
|
|
|
|
|
- |
|
|
|
2 |
|
Non-persistent |
|
|
2.5 |
|
Non-persistent |
|
|
12 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
6.3 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
EU dossier lab studies for pyrethrins |
|
|
|
3.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Peach fruit, n=1 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.5 |
|
Fast |
|
|
Rapid |
|
|
|
528 |
|
Very persistent |
|
|
- |
|
|
3.7 |
|
Fast |
|
|
1.0 |
|
Moderately fast |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Non-mobile |
|
|
100000 |
|
|
Literature data |
|
|
|
298 |
|
Non-mobile |
|
|
27019 |
|
|
0.986 |
|
|
EU dossier data for pyrethrins Kf range 198-430 mL g⁻¹, kfoc range 12472-74175 mL g⁻¹, 1/n range 0.907-1.10, Soils=4 |
|
|
No |
| Known groundwater metabolites |
|
None
|
|
|
|
|
| hydroxy-chrysanthenic acid |
- |
Plant |
- |
| dihydroxy-chrysanthenic acid |
- |
Plant |
- |
| dicarboxylic-chrysanthenic acid |
- |
Plant; Humans (Urine) |
- |
| aldehyde-chrysanthenic acid |
- |
Plant |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1050 |
Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 51151 |
Anas platyrhynchos as pyrethrins |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
23.7 |
Eisenia foetida corr |
Moderate |
|
|
0.25 |
Eisenia foetida corr |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.013 |
Apis mellifera |
High |
|
|
0.10 |
Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Aphidius rhopalosiphi |
- |
|
|
Harmless |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.005 |
Oncorhynchus mykiss as pyrethrins |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.273 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.0014 |
Americamysis bahia as pyrethrins |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
320 |
S1 S = Expert judgement 1 = Estimated data with little or no verification Unknown species |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
|
1050 |
Rat |
Moderate |
|
|
> 2000 |
Rat as Pyrethrins |
- |
|
|
3.4 |
Rat as Pyrethrins |
- |
|
|
Intraperitoneal LD₅₀ = 200 mg kg⁻¹ |
Rat Pyrethrins |
- |
|
|
0.04 |
Rat SF=100 |
- |
|
|
0.2 |
Rat SF=100 |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
10 |
default |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Almost completely excreted within 72hrs |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
|
May cause dermatitis May cause gastointestinal problems Possible thyroid and liver toxicant |
|
|
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable IMDG Transport Hazard Class 9 |
|
|
Health: H332, H312, H302 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN3082 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
pyrethrins (cinerin I) |
|
|
pyrethrines |
|
|
Pyrethrine |
|
|
pyrethrin |
|
|
piretrine |
|
|
piretrina |
|
|
- |
|
|
pyretryny |
|
|
pyretriner |
|
|
- |
|
|
pyrethrinen |
|
|
- |
| Record last updated: |
22/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |