| Pyrethrins (pyrethrin II) (Ref: ENT 7543 ) |

Last updated: 04/02/2026
|
 |
(Also known as: pyrethum) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
A non-persistent insecticide extracted from Pyrethrum, used to control a variety of pests on crops, in domestic and public health situations |
|
|
A wide range of insects and mites |
|
|
Vegetables; Fruit; Protected crops; Ornamentals; Public areas |
|
|
- |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Italy/Germany |
|
|
15/06/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
  |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
USA, East Africa, Australia |
|
|
Pyrethrin II exhibits both stereoisomerism and geometric isomerism. The molecule contains three chiral centres,two in the cyclopropane ring and one in the cyclopentenone moiety, which give rise to optical isomers. Pyrethrin II also includes conjugated double bonds in its pentadienyl side chain and methoxypropenyl group, introducing E/Z (cis/trans) geometric isomerism. The naturally occurring form is typically the (1R,3R)-cis isomer with (Z)-configuration at the pentadienyl double bond and (E)-configuration at the methoxypropenyl double bond. |
|
|
C₂₂H₂₈O₅ |
|
|
CC1=C(C(=O)CC1OC(=O)C2C(C2(C)C)C=C(C)C(=O)OC)CC=CC=C |
|
|
CC1=C(C(=O)C[C@@H]1OC(=O)[C@@H]2[C@H](C2(C)C)/C=C(\C)/C(=O)OC)C/C=C\C=C |
|
|
VJFUPGQZSXIULQ-QYVAASDLSA-N |
|
|
InChI=1S/C22H28O5/c1-7-8-9-10-15-14(3)18(12-17(15)23)27-21(25)19-16(22(19,4)5)11-13(2)20(24)26-6/h7-9,11,16,18-19H,1,10,12H2,2-6H3/b9-8+,13-11+/t16-,18+,19+/m1/s1 |
|
|
Yes |
|
|
Insecticide; Acaricide; Veterinary substance |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Contact acting neurotoxins with repellent properties. Sodium channel modulator. |
|
|
Orginally isolated from the dried powdered flowers of the plant genus Chrysanthemum |
|
|
Crop protection; Public health |
|
|
A wide range of insects and mites |
|
|
Vegetables; Fruit; Protected crops; Ornamentals; Public areas |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
121-29-9 |
|
|
8003-34-7 |
|
|
204-462-6 |
|
|
32 |
|
|
069002 |
|
|
- |
|
|
372.4 |
|
|
- |
|
|
(Z)-(S)-2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl (E)-(1R)-trans-3-(2-methoxycarbonylprop-1-enyl)-2,2–dimethylcyclopropanecarboxylate |
|
|
(1R-(1α(S(Z),3β(E)))-2-methyl-4-oxo-3-(2,4-pantadienyl)cyclopenten-1-yl 3-(3-methoxy-2-methyl-3-oxo-1-propenyl)-2,2-dimethylcyclopropanecarboxylate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R09 Rule 9: Pesticide active ingredients that have demonstrated a high aquatic toxicity (where acute ecotoxicity for fish, invertebrates or algae =< 0.1 mg l⁻¹) ; R10 Rule 10: Pesticide active ingredients that have demonstrated a high toxicity to bees (where contact or oral bee toxicity =< 2 μg bee⁻¹) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
3A |
|
|
Not applicable |
|
|
Blattella germanica, Boophilus decoloratus, Myzus persicae, Plodia interpunctella, Spodoptera litura, many others |
|
|
Viscous amber coloured liquid |
|
|
|
|
|
|
|
|
Current |
|
|
Circa 1930, introduced |
|
|
- MGK
- Diatect International
- Agropharm Ltd
|
|
|
- Evergreen Crop Protection 60-6
- Diatect II
- Pyrethrum 5EC concentrate
|
|
|
Available in a variety of formulations including ultra low-volume liquids and ready-to-use sprays for crop and public health applications and as powders, shampoos and impregnated collars for animals. |
|
|
Chrysanthemum cinerariifolium plants are cultivated and once blooming the flowers are harvested and dried. The dried flower heads are processed to extract the pyrethrins. This is typically done using a proprietary extraction method that maintains the natural composition of the pyrethrins. The crude extract contains a mixture of pyrethrins, including pyrethrin I, pyrethrin II, cinerins, and jasmolins. Pyrethrin II is isolated using chromatography and fraction collection. The collected fraction is then purified. |
|
|
There are no precise, published data on the GHG emissions associated with the production of pyrethrins. However, based on similar plant-derived biopesticides, the estimated emissions would be expected to be around 3.0–6.5 kg CO₂e per kg of pyrethrins. |
|
|
|
|
|
|
|
|
|
|
10.7 |
|
Moderate |
|
|
250000 |
n-Heptane |
- |
| 250000 |
p-Xylene |
- |
| 250000 |
Methane |
- |
| 250000 |
Acetone |
- |
|
|
132 |
|
- |
|
|
- |
- |
- |
|
|
140 |
|
- |
|
|
- |
- |
- |
|
|
|
2.09 X 1004 |
Calculated |
- |
|
|
4.32 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.85 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Not applicable |
|
- |
| No dissociation |
|
|
1.22 X 10-02 |
|
Low volatility |
|
|
1.11E02 |
|
Volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
52.8 |
as pyrethrins |
- |
|
|
|
|
|
|
|
- |
|
|
|
2 |
|
Non-persistent |
|
|
2.5 |
|
Non-persistent |
|
|
12 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
6.3 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
EU dossier lab studies for pyrethrins |
|
|
|
1.07 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.02-5.2 days, 4 field crops, fruit & leaves, n=6 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.5 |
|
Fast |
|
|
Rapid |
|
|
|
528 |
|
Very persistent |
|
|
- |
|
|
3.7 |
|
Fast |
|
|
1.0 |
|
Moderately fast |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Non-mobile |
|
|
100000 |
|
|
Literature data |
|
|
|
298 |
|
Non-mobile |
|
|
27019 |
|
|
0.986 |
|
|
EU dossier data for pyrethrins Kf range 198-430 mL g⁻¹, kfoc range 12472-74175 mL g⁻¹, 1/n range 0.907-1.10, soils=4 |
|
|
No |
| Known groundwater metabolites |
|
None
|
|
|
|
|
| hydroxy-chrysanthenic acid |
- |
Plant |
- |
| dihydroxy-chrysanthenic acid |
- |
Plant |
- |
| dicarboxylic-chrysanthenic acid |
- |
Plant; Humans (Urine) |
- |
| aldehyde-chrysanthenic acid |
- |
Plant |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
700 |
Rat as pyrethrins |
Moderate |
|
|
57.0 |
Rat 90-day as pyrethrins |
Moderate |
|
|
4.4 |
Rat 2-yr as pyrethrins |
Moderate |
|
|
> 51151 |
Anas platyrhynchos as pyrethrins |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
23.7 |
Eisenia foetida corr |
Moderate |
|
|
0.25 |
Eisenia foetida corr |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.013 |
|
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Aphidius rhopalosiphi |
- |
|
|
Harmless |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
0.005 |
Oncorhynchus mykiss as pyrethrins |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.263 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.0014 |
Americamysis bahia as pyrethrins |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
320 |
S1 S = Expert judgement 1 = Estimated data with little or no verification Unknown species |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) used to calculate Total Applied Toxicity (TAT) |
|
|
|
|
|
|
|
0.88 |
Worst case of acute and chronic mammals |
|
|
5115.1 |
Worst case of acute and chronic birds |
|
|
0.05 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
0.00026 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
5E-05 |
Worst case of temperate acute and chronic fish |
|
|
0.00263 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
32 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
|
700 |
Rat as pyrethrins |
Moderate |
|
|
57.0 |
Rat 90-day as pyrethrins |
Moderate |
|
|
4.4 |
Rat 2-yr as pyrethrins |
Moderate |
|
|
> 2000 |
Rat as Pyrethrins |
- |
|
|
3.4 |
Rat as Pyrethrins |
- |
|
|
Intraperitoneal LD₅₀ = 200 mg kg⁻¹ |
Rat as Pyrethrins |
- |
|
|
0.04 |
Rat SF=100 |
- |
|
|
0.2 |
Rat SF=100 |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
10 |
default |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Almost completely excreted within 72hrs |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
|
May cause dermatitis May cause gastointestinal problems Possible thyroid and liver toxicant |
|
|
|
|
|
Not explosive or oxidising IMDG Transport Hazard Class 9 Not expected to auto-ignite; Not highly flammable |
|
|
Health: H332, H312, H302 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN3082 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
pyrethrins (pyrethrin II) |
|
|
pyrethrines |
|
|
Pyrethrine |
|
|
pyrethrin |
|
|
piretrine |
|
|
piretrina |
|
|
- |
|
|
pyretryny |
|
|
pyretriner |
|
|
- |
|
|
pyrethrinen |
|
|
- |
| Record last updated: |
04/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.