| Sucrose |

Last updated: 14/02/2026
|
 |
(Also known as: saccharose ; cane sugar; table sugar; sugar) |
| Sucrose is a disaccharide without pesticidal activity but which can enhance a plants natural defences. Whilst data is scant, sucrose is not a substance of environmenal or toxicological concern when used for plant protection purposes. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
A natural plant sugar comprised of one molecule of glucose and one molecule of fructose. Sucrose does not have pesticidal activity but it can enhance a plants natural defences. Also used as an insectn attractant. |
|
|
Boring insects such as Cydia pomonella; Vine leaf hopper; Downy mildew |
|
|
Apple; Maize; Grapes |
|
|
- |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
- |
|
|
Open ended |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Sucrose has four naturally occurring isomers - trehalulose, turanose, leucrose, and isomaltulose |
|
|
C₁₂H₂₂O₁₁ |
|
|
C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O |
|
|
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H](O2)CO)O)O)CO)O)O)O)O |
|
|
CZMRCDWAGMRECN-UGDNZRGBSA-N |
|
|
InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| sucrose |
- |
 |
| sucrose |
- |
 |
|
|
Insecticide; Fungicide; Other substance |
|
|
Attractant; Elicitor |
|
|
Plant-derived substance |
|
|
Food grade purity |
|
|
- |
|
|
Natural |
|
|
Stimulates plant natural defence systems and used as an lure to improve pesticide exposure |
|
|
- |
|
|
Natural fruit sugar |
|
|
Crop protection |
|
|
- |
|
|
57-50-1 |
|
|
200-334-9 |
|
|
- |
|
|
- |
|
|
- |
|
|
342.30 |
|
|
(2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|
|
(2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|
|
α-D-glucopyranosyl-(1↔2)-β-D-fructofuranoside |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
EU Basic substance under Article 28 of Regulation (EC) No 1107/2009); UK Basic commodity substance implemented under the UK's Plant Protection Products Regulations 2011 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
None |
|
|
White crystalline solid with sweet taste |
|
|
|
|
|
|
|
|
Current |
|
|
- |
|
|
|
|
|
- |
|
|
- |
|
|
Commercial production of sucrose for agricultural applications primarily involves extracting sugar from sugarcane or sugar beet. The process begins with harvesting and crushing the plant material to extract juice rich in sucrose. This juice is then clarified, concentrated through evaporation, and crystallised to produce raw sugar. Sucrose may also be further refined or blended with other nutrients depending on the intended application. In some innovative approaches, enzymatic processes are used to convert starch into sucrose or glycoside derivatives, expanding its utility beyond traditional sweetener roles. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
2100000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
330 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Decomposes on boiling |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
186 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
2.00 X 10-04 |
Calculated |
- |
|
|
-3.7 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.58 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
12.62 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
71 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
| Known soil and groundwater metabolites |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 29700 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
2970 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
> 29700 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
No risks identified |
|
|
No risks identified |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
  |
|
|
|
Sucrose is not a substance of significant toxicological concern when used for crop protection Sucrose is linked to obesity and diabetes |
|
|
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
sucrose |
|
|
saccharose |
|
|
- |
|
|
- |
|
|
zucchero |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
suiker |
|
|
- |
| Record last updated: |
14/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.