| Onion oil |

Last updated: 15/02/2026
|
 |
(Also known as: Oil of Allium cepa L.; Allium cepa L. bulb extract) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
Oil or aqueous extract derived from Allium cepa L. used as an insect repellent or fungicide |
|
|
Carrot root fly (psila rosae); Early blight; Tomato late blight; Grey mold; Common insect pests |
|
|
Carrots, Celeriac, Parsnips, Parsley; Potatoes, Tomatoe; Cucumber |
|
|
- |
|
|
- |
|
|
Class: Magnoliopsida; Order: Asparagales; Family: Amaryllidaceae |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
- |
|
|
Open ended |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
| ✓ |
✓ |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Onion oil is a complex natural extract than contains variety of sulphur-containing molecules, fatty acids, and volatile organic compounds, some of which exhibit isomerism. For example, its sulphur-containing compounds like thiols, sulphides, and disulphides can exist in structural isomeric forms, depending on how the sulphur atoms are bonded. Fatty acids such as linoleic, oleic, and palmitic acids, present in onion oil, can undergo cis-trans isomerism, especially under heat or light exposure. |
|
|
C₇H₁₆ClNO₂ |
|
|
CCC(C)C(C(=O)OC)N.Cl |
|
|
CC[C@@H](C)[C@H](C(=O)OC)N.Cl |
|
|
GGTBEWGOPAFTTH-KGZKBUQUSA-N |
|
|
InChI=1S/C7H15NO2.ClH/c1-4-5(2)6(8)7(9)10-3;/h5-6H,4,8H2,1-3H3;1H/t5-,6-;/m1./s1 |
|
|
No |
|
|
Repellent; Insecticide; Fungicide |
|
|
Plant-derived substance; Plant oil |
|
|
Food grade quality |
|
|
EU dossier: none reported |
|
|
Natural; Complex mixture |
|
|
As a repellent works via scent masking - aroma originates from plant roots and foliage rich in linoleic, oleic and palmitic acids. Mode of action as a fungicide is unreported. |
|
|
- |
|
|
Extracted from the bulb of Allium cepa L. |
|
|
The chemical composition of onion oil is a complex mixture dominated by volatile organosulphur compounds and also includes fatty acids and other volatiles. The primary active compounds responsible for its biopesticidal properties are mainly dipropyl disulphide (20-60%)and dipropyl trisulphide. Other common ones include methyl 5-methylfuryl sulphide, methyl 3,4-dimethyl-2-thienyl disulphide, 1-propenyl propyl disulphide and propenyl disulphides. Fatty acids (especially in seed-derived or certain bulb oils/extracts contribute to the oily nature and add to the activity. These include linoleic acid (50-65%), oleic acid (20-26%) and palmitic acid (6-7%). There may also be other trace components, The exact profile varies by extraction method, onion variety and plant part (bulb vs. seed), but organosulphur compounds are consistently highlighted as the bioactive core for pesticidal uses. |
|
|
Crop protection |
|
|
- |
|
|
8002-72-0 |
|
|
232-498-2 |
|
|
- |
|
|
- |
|
|
53472027 |
|
|
181.66 |
|
|
methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride |
|
|
methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride |
|
|
- |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
EU Basic substance under Article 28 of Regulation (EC) No 1107/2009); UK Basic commodity substance implemented under the UK's Plant Protection Products Regulations 2011 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Oily amber to yellow coloured liquid comprised of various fatty acids dominated by linoleic acid (~65%) |
|
|
|
|
|
|
|
|
Current |
|
|
2010, start of formal agricultural trials |
|
|
|
|
|
|
|
|
Use in oil dispensers as insect repellent and as a spray when used as a fungicide |
|
|
Commercial production of onion oil begins with cultivating and harvesting onions. The oil is extracted from the bulbs using steam distillation, which isolates the desirable volatile compounds. Some manufacturers also use solvent extraction for specialised formulations. After extraction, the oil is filtered and refined to ensure purity and consistency. |
|
|
Data for specific plant oils is scarce. However, from publicly available data the carbon footprint of plant oils has been estimated at between 1.0 and 4.0 kg CO₂e per kg of oil. This depends on the plant oil content, agricultural practices and processing methods used. |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
41 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.02 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
100 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Minimal risks for the public from proposed uses |
|
|
PPC recommended |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
  |
|
|
|
Irritant and skin sensitiser |
|
|
|
|
|
Flammable liquid when forumated as an oil Use foam or carbon dioxide in firefighting - not water May produce hazardous organic compounds in a fire Not oxidising agent IMDG Transport Hazard Class 3 |
|
|
Health: H226, H317 Environment: H401, H410 |
|
|
Not listed |
|
|
UN1197 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
onion oil |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
15/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.