Fenpiclonil (Ref: CGA 142705) |
Last updated: 02/05/2024
|
|
(Not known by any other names) |
Fenpiclonil is a pyrrole, broad-spectrum fungicide usually used to control seed-borne pathogens in cereal crops and was also used as a wood preservative but is now considered obsolete. It has a low aqueous solubility and a low volatility. Whilst it may be persistent in soil systems, it is less so in water systems. Fenpiclonil is moderately toxic to birds, honeybees, fish, aquatic invertebrates and algae. It has a low oral toxicity to humans. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A pyrrole fungicide usually used to control seed-borne pathogens in cereal crops but it also has other uses |
|
Seed-borne diseases |
|
Cereals including spring barley and winter wheat |
|
- |
|
- |
|
1988, first reported; 1988, Introduced Switzerland |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₁H₆Cl₂N₂ |
|
C1=CC(=C(C(=C1)Cl)Cl)C2=CNC=C2C#N |
|
No data |
|
FKLFBQCQQYDUAM-UHFFFAOYSA-N |
|
InChI=1S/C11H6Cl2N2/c12-10-3-1-2-8(11(10)13)9-6-15-5-7(9)4-14/h1-3,5-6,15H |
|
Yes |
|
Fungicide, Other substance |
|
Wood preservative |
|
Phenylpyrrole fungicide |
|
- |
|
- |
|
Synthetic |
|
Broad-spectrum, long-lasting activity, inhibits glucose phosphorylation. Osmotic signal transduction. |
|
74738-17-3 |
|
616-132-2 |
|
519 |
|
- |
|
91724 |
|
No data found |
|
237.08 |
|
4-(2,3-dichlorophenyl)-1H-pyrrole-3-carbonitrile |
|
4-(2,3-dichlorophenyl)-1H-pyrrole-3-carbonitrile |
|
4-(2,3-dichlorophenyl)-1H-pyrrole-3-carbonitrile |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
12 |
|
- |
|
White crystals |
|
|
|
|
|
- Beret Combi
- Beret Special
- Galbas
|
|
Available in a wide range of formulations including water dispensible powders, flowable concentrates, powder for dry seed treatments and emulsifiable concentrate |
|
|
|
|
|
4.8 |
|
Low |
|
73000 |
Ethanol |
- |
360000 |
Acetone |
- |
7200 |
Toluene |
- |
26 |
n-Hexane |
- |
|
145 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
7.24 X 1003 |
Calculated |
- |
|
3.86 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.53 |
|
- |
|
Not applicable |
|
- |
No dissociation |
|
1.10 X 10-04 |
|
Low volatility |
|
5.40 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
242 |
|
Persistent |
|
242 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Lab studies DT₅₀ range 232-252 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
0.03 |
|
Fast |
|
- |
|
|
23 |
|
Non-persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
26.1 |
|
Slightly mobile |
|
1447 |
|
UK dossier Kd range 18.1-40.5 mL g⁻¹, Koc range 1311-1902 mL g⁻¹, Soils=3 |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
2.00 |
Calculated |
Transition state |
|
|
8.38 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
346 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
5 |
Rat |
High |
|
100 |
- |
|
- |
- |
- |
|
100 |
Anas platyrhynchos |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
100 |
Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
5 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.8 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1.3 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.22 |
Raphidocelis subcapitata 5 day |
Moderate |
|
0.1 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Harmful by inhalation |
|
|
|
No information available |
|
Health: H332 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
fenpiclonil |
|
fenpiclonil |
|
Fenpiclonil |
|
fenpiclonil |
|
fenpiclonil |
|
fenpiclonil |
|
- |
|
fenpiklonil |
|
fenpiklonil |
|
- |
|
- |
|
- |
Record last updated: |
02/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |