Bifenox acid |
Last updated: 24/07/2024
|
|
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Chemical transformation product |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₃H₇Cl₂NO₅ |
|
C1=CC(=C(C=C1OC2=C(C=C(C=C2)Cl)Cl)C(=O)O)[N+](=O)[O-] |
|
No data |
|
IUSYSZLVZMUVDO-UHFFFAOYSA-N |
|
InChI=1S/C13H7Cl2NO5/c14-7-1-4-12(10(15)5-7)21-8-2-3-11(16(19)20)9(6-8)13(17)18/h1-6H,(H,17,18) |
|
Yes |
|
Metabolite |
|
Soil, Groundwater |
|
Unclassified substance |
|
- |
|
- |
|
Synthetic |
|
Inhibition of protoporphyrinogen oxidase (PPO) - cell membrane disruption |
|
53774-07-5 |
|
- |
|
- |
|
Not listed |
|
- |
|
328.10 |
|
- |
|
- |
|
5-(2,4-dichlorophenoxy)-2-nitrobenzoic acid |
|
- |
|
- |
|
E |
|
14 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
1000 |
|
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.55 X 1004 |
Calculated |
- |
|
4.55 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.58 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
56 |
|
Moderately persistent |
|
56.3 |
|
Moderately persistent |
|
- |
- |
- |
|
298 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
EU dossier lab study range DT₅₀ 24-156 days, DT₉₀ range 79.7-517 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
1.85 |
|
Moderately mobile |
|
143 |
|
0.84 |
|
EU dossier kf range 0.68-3.62 mL g⁻¹, Kfoc range 130-155 mL g⁻¹, 1/n range 0.79-0.89, Soils=3 |
|
No |
|
|
|
|
|
3.23 |
Calculated |
High leachability |
|
|
4.15 X 10-01 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida |
Low |
|
- |
- |
- |
|
Nitrogen mineralisation: No significant adverse effect Carbon mineralisation: No significant adverse effect |
Dose: 0.959 mg kg⁻¹ soil 28 Day |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
3.9 |
Lemna gibba |
Moderate |
|
2.22 |
Desmodesmus subspicatus |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H301 Environment: H400, H410 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
bifenox acid |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
kwas 5-(2,4-dichlorofenoksy)-2-nitrobenzoesowy |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
24/07/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |