Oxytetracycline hydrochloride |

Last updated: 30/05/2024
|
 |
(Also known as: terramycin; oxytracyl; oxytetrin; terramitsin; oxitetracycline; crop antibiotic) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A bactericide used to control bacteria, fungi and mycoplasma-like organisms in fruit and turf, also used in veterinary products and for aquaculture |
|
Current |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes as oxytetracycline |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A complex molecule with 6 chiral centres |
|
C₂₂H₂₅ClN₂O₉ |
|
CC1(C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O)O.Cl |
|
C[C@@]1([C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O)O.Cl |
|
SVDOODSCHVSYEK-IFLJXUKPSA-N |
|
- |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
|
Veterinary substance, Other substance |
|
Antimicrobial, Bactericide, Crop antibiotic |
|
Micro-organism derived substance |
|
- |
|
- |
|
Natural |
|
Broad spectrum, protein synthesis inhibitor and binds to the 30S and 50S bacterial ribosomal subunits |
|
2-58-46-0 |
|
218-161-2 |
|
- |
|
- |
|
- |
|
496.90 |
|
(4S,4aR,5S,5aR,6S,12aR)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
|
(4S,4aR,5S,5aR,6S,12aR)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
|
- |
|
Possible groundwater contaminant |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
41 |
|
- |
|
Yellow crystalline powder |
|
|
|
|
|
|
|
- Mycoshield
- Cuprimicina Agrıcola
- Cuprimicın 100
- Mycoject
|
|
Supplied as a water soluble powder for preparation as injection when used as a veterinary product. For crop protection it is used as a foliar spray |
|
|
|
|
|
6900 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
High |
|
- |
- |
- |
|
121 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.03 X 10-02 |
Calculated |
- |
|
-1.22 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.63 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
4.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
Weak acid |
|
1.29 X 10-19 |
at 25 °C |
Low volatility |
|
1.72 X 10-20 |
at 25 °C |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
18 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
21 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature estimates give DT₅₀ 1 to 10 wks |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
9 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderately fast |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
698 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-mobile |
|
52875 |
|
Literature data: Kd range 417-1626 mL g⁻¹, Koc range 27792-93317 mL g⁻¹, soils=4; Other Literature data 27792-93317 generally quoted for tetracyclines (R4) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-0.96 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
0.6 |
Mollusca |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 4800 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5620 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
1954 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
100 |
|
Moderate |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
116 |
Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
102 |
Daphnia magna |
Low |
|
46.2 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.342 |
R4 R = Peer reviewed scientific publications 4 = Verified data Selenastrum capricornutum |
Moderate |
|
0.183 |
R4 R = Peer reviewed scientific publications 4 = Verified data Selenastrum capricornutum |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 4800 |
Rat |
Low |
|
5700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
- |
- |
- |
|
Intraperitoneal LD₅₀ = 260 mg kg⁻¹ |
Mouse |
- |
Intravenous LD₅₀ = 260 mg kg⁻¹ |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Systemically available oxytetracycline was primarily excreted in the urine and bile |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
May cause hypersensitivity reactions May cause tooth discoloration |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
oxytetracycline hydrochloride |
|
oxytetracycline |
|
Oxytetracyclin |
|
oxytetracyclin |
|
oxytetracicline |
|
oxitetraciclina |
|
- |
|
oksytetracyklina |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
30/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |