Parathion-methyl (Ref: OMS 213) |
![]() Last updated: 27/11/2019 |
![]() |
(Also known as: metaphos; meptox; thiophenit; quinophos; methyl-parathion) |
|
![]() |
|
An insecticide used to control sucking and chewing insects in a wide range of crops | |
---|---|---|
|
Aphids; Boll weevils; Mealybugs; Scale; Armyworms | |
|
Cereals; Cotton; Vegetables; Soybean; Fruit; Vines | |
|
- | |
|
Current | |
|
circa 1950 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Italy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Australia, USA, Costa Rica |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₈H₁₀NO₅PS | |
|
COP(=S)(OC)OC1=CC=C(C=C1)[N+](=O)[O-] | |
|
No data | |
|
RLBIQVVOMOPOHC-UHFFFAOYSA-N | |
|
InChI=1S/C8H10NO5PS/c1-12-15(16,13-2)14-8-5-3-7(4-6-8)9(10)11/h3-6H,1-2H3 | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
parathion-methyl | - | ![]() |
General status |
|
Insecticide | |
---|---|---|
|
Organophosphate | |
|
- | |
|
- | |
|
Synthetic | |
|
Contact and stomach insecticide. Cholinesterase inhibitor. | |
|
298-00-0 | |
|
206-050-1 | |
|
487 | |
|
053501 | |
|
4130 | |
|
263.21 | |
|
- | |
|
O,O-dimethyl O-4-nitrophenyl phosphorothioate | |
|
O,O-dimethyl O-(4-nitrophenyl) phosphorothioate | |
|
Chemical subject to PIC regulations; Potential groundwater contaminant; Marine Pollutant | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1B | |
|
Not applicable | |
|
Aedes melanimon, Aedes nigromaculis, Anopheles albimanus, Coleomegilla maculata, Culex pipiens pallens, many others | |
|
Colourless crystals | |
|
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Available in a wide variety of formulations including dustable powders, emulsifible concentrates, encapsulated suspensions, ULV liquid and wettable powders. |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
55 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
200000 | L3 L = Pesticide manuals and hard copy reference books / other sources Dichloromethane3 = Unverified data of known source |
- | ||||||||
200000 | L3 L = Pesticide manuals and hard copy reference books / other sources Toluene3 = Unverified data of known source |
- | |||||||||
15000 | L2 L = Pesticide manuals and hard copy reference books / other sources Hexane2 = Unverified data of unknown source |
- | |||||||||
|
35.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
150 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
1.00 X 1003 | Calculated | - | |||||||
|
3 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
1.36 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
8.57 X 10-03 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
12 | Y4 Y = Germany's Federal Environment Agency (UBA) (click here ) 4 = Verified data |
Non-persistent | |||||||
|
12 | Y4 Y = Germany's Federal Environment Agency (UBA) (click here ) 4 = Verified data |
Non-persistent | ||||||||
|
10 | Y4 Y = Germany's Federal Environment Agency (UBA) (click here ) 4 = Verified data |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
PIC DGD states lab DT₅₀ range 1-18 days | ||||||||||
|
|
3.6 | R4 R = Peer reviewed scientific publications 4 = Verified data |
- | |||||||
|
Published literature RL₅₀ range 0.4-6.7 days, 6 field crops, various matrices, n=8 | ||||||||||
|
|
1.9 | R4 R = Peer reviewed scientific publications 4 = Verified data |
- | |||||||
|
Published literature RL₅₀ range 0.7-6.6 days, 7 field crops, various matrices, n=12; Fruit in cold storage RL₅₀ range 63-65 days, n=2 | ||||||||||
|
|
9 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Moderately fast | |||||||
|
- | ||||||||||
|
|
21 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Non-persistent | |||||||
|
- | ||||||||||
|
5 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Fast | ||||||||
|
15 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slow |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | W3 W = French database provided by ARVALIS-Institut du Végétal 3 = Unverified data of known source |
Moderately mobile | |||||||
|
240 | ||||||||||
|
- | ||||||||||
|
|
34.4 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile | |||||||
|
442 | ||||||||||
|
1.038 | ||||||||||
|
Literature data: Kf range 8.0-37.8 (178 for peat) mL g⁻¹, Kfoc range 276-677 (276 for peat) mL g⁻¹, 1/n range 0.909-1.123, Soils=8 | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
1.35 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
1.93 X 10-02 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Moderately mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
71 | J3 J = Pesticide Action Network database (click here ) Oncorhynchus mykiss3 = Unverified data of known source |
Low potential | |||||||
|
Not available | - | |||||||||
|
3 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
High | ||||||||
|
|
- | L2 L = Pesticide manuals and hard copy reference books / other sources Rat 2 year2 = Unverified data of unknown source |
- | |||||||
|
2 | - | |||||||||
|
- | - | - | ||||||||
|
> 1044 | L3 L = Pesticide manuals and hard copy reference books / other sources Anas platyrhynchos3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 2.7 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Moderate | ||||||||
|
0.0089 | P3 P = Other governments and regulators Cyprinodon variegatus3 = Unverified data of known source |
High | ||||||||
|
> 0.0073 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
High | ||||||||
|
0.00018 | P3 P = Other governments and regulators Daphnia magna3 = Unverified data of known source |
High | ||||||||
|
0.00035 | F3 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) Americamysis bahia3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
3 | L3 L = Pesticide manuals and hard copy reference books / other sources Scenedemus subspicatus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
19.5 | F4 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) 4 = Verified data |
Moderate | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
0.0157 | R4 R = Peer reviewed scientific publications Megachile rotundata4 = Verified data |
High | |||||||
|
Contact | ||||||||||
|
|
0.096 | R4 R = Peer reviewed scientific publications Trigona spinipes4 = Verified data |
High | |||||||
|
Contact | ||||||||||
|
40 | L3 L = Pesticide manuals and hard copy reference books / other sources Eisenia foetida3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
3 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
High | ||||||||
|
45.0 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
0.17 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.003 | F4 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) JMPR 19954 = Verified data |
- | ||||||||
|
0.03 | B4 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) UK ACP 19994 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List I; List II | - | - | ||||||||
|
|
- | |||||||||
|
Skin absorption, and to a lesser extent inhalation and ingestion | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Extremely hazardous IARC Group 3 carcinogen; USEPA - not likely to be a human carcinogen |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Explosive on heating Flammable IMDG Transport Code is 6.1 |
|||
|
Handling: H226 Health: H300, H311, H330, H373 Environment: H400, H410 |
|||
|
T+ - Very toxic: R26/28 T - Toxic: R24 Xn - Harmful: R48/22 H - Handling risks: R5, R10 N - Dangerous for the environment: R50, R53 |
|||
|
S1/2, S28, S36/37, S45, S60, S61 | |||
|
Ia (Extremely hazardous) | |||
|
Active 2783, liquid products 3018 | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
parathion-methyl | ||
|
parathion-methyl | ||
|
Parathion-methyl | ||
|
parathion-methyl | ||
|
paration-metile | ||
|
paratión-metil | ||
|
parathion-methyl | ||
|
paration metylu | ||
|
- | ||
|
- | ||
|
parathion-methyl |
Record last updated: | 27/11/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |