Fluazifop-P (Ref: R156172) |
![]() Last updated: 23/01/2021 |
![]() |
(Also known as: fluazifop-P acid) |
|
![]() |
|
A herbicide that is normally used as the butyl derivative. Also a chemical transformation product | |
---|---|---|
|
Volunteer cereals, Annual and perennial grass weeds | |
|
Soybeans; Carrots; Spinach; Potatoes; Ornamentals | |
|
- | |
|
Current | |
|
1981, first marketed |
UK regulatory status |
|
Approved | ||
---|---|---|---|
|
31/12/2024 | ||
|
None |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
France/Italy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
31/12/2021 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
Fluazifop-P is the R-isomer of fluazifop. | |
---|---|---|
|
C₁₅H₁₂F₃NO₄ | |
|
CC(C(=O)O)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F | |
|
C[C@H](C(=O)O)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F | |
|
YUVKUEAFAVKILW-SECBINFHSA-N | |
|
InChI=1S/C15H12F3NO4/c1-9(14(20)21)22-11-3-5-12(6-4-11)23-13-7-2-10(8-19-13)15(16,17)18/h2-9H,1H3,(H,20,21)/t9-/m1/s1 | |
|
Yes |
General status |
|
Herbicide, Metabolite | |
---|---|---|
|
Soil | |
|
Unclassified | |
|
- | |
|
- | |
|
Synthetic | |
|
Not applicable | |
|
83066-88-0 | |
|
- | |
|
- | |
|
Not applicable | |
|
- | |
|
327.26 | |
|
- | |
|
(R)-2-(4-((5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoic acid | |
|
(R)-2-(4-((5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy-propanoic acid | |
|
- | |
|
- | |
|
A | |
|
1 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
- | |
|
Can be a metabolite of: |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
fluazifop-P-butyl | Soil | 0.834 | Major fraction, Relevant |
Formulations |
|
|
|||
---|---|---|---|---|
|
- | |||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
40.5 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) at 25 °C3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.51 X 1003 | Calculated | - | |||||||
|
3.18 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
3.12 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
- | ||||||||
Weak acid | |||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
25 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
15 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Slow | |||||||
|
- | ||||||||||
|
|
Stable | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Stable | |||||||
|
- | ||||||||||
|
43 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Moderately fast | ||||||||
|
45 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Stable |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
7.1 | A4 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications ) 4 = Verified data |
Moderately mobile | |||||||
|
205 | ||||||||||
|
EU dossier Kd range 1.1-13.1 mL g⁻¹, Koc range 106-304 mL g⁻¹, Soils=6 | ||||||||||
|
|
1.10 | A5 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications ) 5 = Verified data used for regulatory purposes |
Mobile | |||||||
|
48.72 | ||||||||||
|
0.64 | ||||||||||
|
EU dossier kf range 0.8-2.1 mL g⁻¹, Kfoc range 38.5-83.6 mL g⁻¹, 1/n range 0.52-0.82, Soils=6 | ||||||||||
|
No |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.23 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
3.24 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Moderately mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | 0.249 | Major fraction, Relevant |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H361d Environment: H400, H410 |
|||
|
- | |||
|
- | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
fluazifop-P | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 23/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |