| Terpinen-4-ol |

Last updated: 16/09/2025
|
 |
(Also known as: Tea tree oil extract; Oil of Melaleuca; TTO; 4-carvomenthenol ; 4-terpinenol) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A major component (30-48%) of Tea tree oil which is used to control various fungal pathogens on a wide range of crops |
|
|
Various fungal pathogens including powdery mildew and early blight |
|
|
Potatoes; Carrots: Tomatoes: Cucumbers: Fruit: Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved (as Tea tree oil) |
|
|
Poland/Bulgaria |
|
|
31/01/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Terpinen-4-ol exhibits stereoisomerism, specifically optical isomerism, due to the presence of a chiral centre at the carbon bearing the hydroxyl group. This carbon is bonded to four different groups: a hydrogen, a hydroxyl (–OH), a methyl group, and the rest of the cyclohexene ring system, making it stereogenic. As a result, terpinen-4-ol exists as two enantiomers: (4S)-(-)-terpinen-4-ol and (4R)-(+)-terpinen-4-ol forms. |
|
|
C₁₀H₁₈O |
|
|
CC1=CCC(CC1)(C(C)C)O |
|
|
No data |
|
|
WRYLYDPHFGVWKC-UHFFFAOYSA-N |
|
|
InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3 |
|
|
Yes |
|
|
Fungicide; Other substance |
|
|
Animal feed additive; Microbiocide |
|
|
Plant-derived substance |
|
|
300 g/Kg |
|
|
- |
|
|
Natural |
|
|
Tea tree oil appears to disrupt the permeability barrier of microbial cell membrane structures, causing loss of chemiosmotic control. |
|
|
Terpinen-4-ol was identified as a major component of tea tree oil, which has been used for its medicinal properties for centuries. |
|
|
Crop protection |
|
|
Various fungal pathogens including powdery mildew and early blight |
|
|
Potatoes; Carrots: Tomatoes: Cucumbers: Fruit: Ornamentals |
|
|
Tea tree oil is suitable for use in all farming systems where approved for use in that country |
|
|
562-74-3 |
|
|
209-235-5 |
|
|
- |
|
|
- |
|
|
- |
|
|
154.25 |
|
|
- |
|
|
1-methyl-4-isopropyl-1-cyclohexen-4-ol |
|
|
terpinen-4-ol |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FLAVIS No. 02.072 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
BM01 |
|
|
- |
|
|
Clear liquid |
|
|
|
|
|
|
|
|
Current |
|
|
1920s, Tea tree oil first reported |
|
|
|
|
|
|
|
|
Tea tree oil is usually supplied as an emulsifable concentrate that is diluted and used as a foliar spray |
|
|
Terpinen-4-ol is produced commercially via extraction from natural sources and chemical synthesis. Steam Distillation is the most common method used to extract terpinen-4-ol from essential oils like tea tree oil (Melaleuca alternifolia). The plant material is subjected to steam, which vaporises the terpinen-4-ol. The vapour is then condensed and collected. Alternatively, fractional distillation or solvent extraction can be used to separate terpinen-4-ol from other components in the essential oil. Terpinen-4-ol can be synthesised from terpinene through a series of chemical reactions, including oxidation and hydrolysis. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
1767 |
|
High |
|
|
- |
- |
- |
|
|
14.7 |
|
- |
|
|
211 |
|
- |
|
|
- |
- |
- |
|
|
79 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source (closed cup) |
- |
|
|
|
2.14 X 1003 |
Calculated |
- |
|
|
3.33 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.933 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
Not applicable |
|
- |
| No dissociation |
|
|
53200 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
4.64 |
|
Moderately volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Mobile |
|
|
61.2 |
|
|
EU dossier - estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1300 |
Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
predicted data |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1300 |
Rat |
Moderate |
|
|
> 2500 |
Rabbit |
- |
|
|
- |
- |
- |
|
|
Intraperitoneal LD₅₀ = 250 mg kg⁻¹ |
Mouse |
- |
| Subcutaneous LD₅₀ = 750 mg kg⁻¹ |
Mouse |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Harmful is swallowed |
|
|
|
|
|
Not explosive or oxidising |
|
|
Health: H302, H315, H317, H319, H336 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
terpinen-4-ol |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
16/09/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |