Gamma-terpinene |

Last updated: 12/02/2025
|
 |
(Also known as: Tea tree oil extract; Oil of Melaleuca; TTO; Crithmene) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
  |
|
|
A component of various essential oils, including tea tree oil, oregano oil, and marjoram oil, and which may be used to control various fungal pathogens on a wide range of crops |
|
Various fungal pathogens including powdery mildew and early blight |
|
Potatoes; Carrots; Tomatoes; Cucumbers; Fruit; Ornamentals |
|
- |
|
- |
|
Current |
|
1920s, Tea tree oil first reported |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved (as Tea tree oil) |
|
Poland/Bulgaria |
|
31/10/2026 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
C₁₀H₁₆ |
|
CC1=CCC(=CC1)C(C)C |
|
No data |
|
YKFLAYDHMOASIY-UHFFFAOYSA-N |
|
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,7-8H,5-6H2,1-3H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
gamma-terpinene |
- |
 |
|
Fungicide |
|
Plant-derived substance |
|
100 g/Kg |
|
- |
|
Natural |
|
Tea tree oil appears to disrupt the permeability barrier of microbial cell membrane structures, causing loss of chemiosmotic control. |
|
Gamma-terpinene was identified as a component of various essential oils, such as tea tree oil, oregano oil, and marjoram oil in the 18th Century and used as a natural remedy to treat various ailments |
|
Gamma-terpinene is produced commercially via extraction from natural sources and chemical synthesis. Steam Distillation is the most common method used to extract gamma-terpinene from essential oils like tea tree oil (Melaleuca alternifolia). The plant material is subjected to steam, which vaporises the gamma-terpinene. The vapour is then condensed and collected. Alternatively, gamma-terpinene can be produced by metabolically engineered microorganisms, such as Escherichia coli and by a fermentation process. |
|
Crop protection |
|
Powdery mildew; Early blight |
|
Potatoes; Carrots; Tomatoes; Cucumbers; Fruit; Ornamentals |
|
Tea tree oil is suitable for use in all farming systems where approved for use in that country |
|
99-85-4 |
|
202-794-6 |
|
- |
|
- |
|
- |
|
138.25 |
|
- |
|
1-methyl-4-isopropyl-1,4-cycloheyadiene |
|
γ-terpinene |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
BM01 |
|
- |
|
Clear liquid |
|
|
|
|
|
|
Timorex |
BioMor Latvija |
|
Tea tree oil is usually supplied as an emulsifable concentrate that is diluted and used as a foliar spray |
|
|
|
|
|
8.72 |
|
Low |
|
- |
- |
- |
|
-31.1 |
|
- |
|
182 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.95 X 1004 |
Calculated |
- |
|
4.47 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Not applicable |
|
- |
No dissociation |
|
93100 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
1476 |
|
Volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
2886 |
|
EU dossier - estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
3650 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
3650 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No adverse health issues noted |
|
|
|
Not explosive or oxidising |
|
Health: H304, H315, H319, H332, H335, H361 Handling: H226 Environment: H411 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
gamma-terpinene |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
12/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |